mirror of
https://github.com/Poniverse/Pony.fm.git
synced 2024-11-26 06:57:58 +01:00
2889 lines
117 KiB
PHP
2889 lines
117 KiB
PHP
|
<?php
|
|||
|
|
|||
|
if (!function_exists('PrintHexBytes')) {
|
|||
|
function PrintHexBytes($string) {
|
|||
|
$returnstring = '';
|
|||
|
for ($i = 0; $i < strlen($string); $i++) {
|
|||
|
$returnstring .= str_pad(dechex(ord(substr($string, $i, 1))), 2, '0', STR_PAD_LEFT).' ';
|
|||
|
}
|
|||
|
return $returnstring;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('PrintTextBytes')) {
|
|||
|
function PrintTextBytes($string) {
|
|||
|
$returnstring = '';
|
|||
|
for ($i = 0; $i < strlen($string); $i++) {
|
|||
|
if (ord(substr($string, $i, 1)) <= 31) {
|
|||
|
$returnstring .= ' ';
|
|||
|
} else {
|
|||
|
$returnstring .= ' '.substr($string, $i, 1).' ';
|
|||
|
}
|
|||
|
}
|
|||
|
return $returnstring;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('table_var_dump')) {
|
|||
|
function table_var_dump($variable) {
|
|||
|
$returnstring = '';
|
|||
|
switch (gettype($variable)) {
|
|||
|
case 'array':
|
|||
|
$returnstring .= '<TABLE BORDER="1" CELLSPACING="0" CELLPADDING="2">';
|
|||
|
foreach ($variable as $key => $value) {
|
|||
|
$returnstring .= '<TR><TD VALIGN="TOP"><B>'.str_replace(chr(0), ' ', $key).'</B></TD>';
|
|||
|
$returnstring .= '<TD VALIGN="TOP">'.gettype($value);
|
|||
|
if (is_array($value)) {
|
|||
|
$returnstring .= ' ('.count($value).')';
|
|||
|
} elseif (is_string($value)) {
|
|||
|
$returnstring .= ' ('.strlen($value).')';
|
|||
|
}
|
|||
|
if (($key == 'data') && isset($variable['image_mime']) && isset($variable['dataoffset'])) {
|
|||
|
require_once(GETID3_INCLUDEPATH.'getid3.getimagesize.php');
|
|||
|
$imageinfo = array();
|
|||
|
$imagechunkcheck = GetDataImageSize($value, $imageinfo);
|
|||
|
$DumpedImageSRC = (!empty($_REQUEST['filename']) ? $_REQUEST['filename'] : '.getid3').'.'.$variable['dataoffset'].'.'.ImageTypesLookup($imagechunkcheck[2]);
|
|||
|
if ($tempimagefile = fopen($DumpedImageSRC, 'wb')) {
|
|||
|
fwrite($tempimagefile, $value);
|
|||
|
fclose($tempimagefile);
|
|||
|
}
|
|||
|
$returnstring .= '</TD><TD><IMG SRC="'.$DumpedImageSRC.'" WIDTH="'.$imagechunkcheck[0].'" HEIGHT="'.$imagechunkcheck[1].'"></TD></TR>';
|
|||
|
} else {
|
|||
|
$returnstring .= '</TD><TD>'.table_var_dump($value).'</TD></TR>';
|
|||
|
}
|
|||
|
}
|
|||
|
$returnstring .= '</TABLE>';
|
|||
|
break;
|
|||
|
|
|||
|
case 'boolean':
|
|||
|
$returnstring .= ($variable ? 'TRUE' : 'FALSE');
|
|||
|
break;
|
|||
|
|
|||
|
case 'integer':
|
|||
|
case 'double':
|
|||
|
case 'float':
|
|||
|
$returnstring .= $variable;
|
|||
|
break;
|
|||
|
|
|||
|
case 'object':
|
|||
|
case 'null':
|
|||
|
$returnstring .= string_var_dump($variable);
|
|||
|
break;
|
|||
|
|
|||
|
case 'string':
|
|||
|
$variable = str_replace(chr(0), ' ', $variable);
|
|||
|
$varlen = strlen($variable);
|
|||
|
for ($i = 0; $i < $varlen; $i++) {
|
|||
|
if (preg_match('#['.chr(0x0A).chr(0x0D).' -;0-9A-Za-z]#', $variable{$i})) {
|
|||
|
$returnstring .= $variable{$i};
|
|||
|
} else {
|
|||
|
$returnstring .= '&#'.str_pad(ord($variable{$i}), 3, '0', STR_PAD_LEFT).';';
|
|||
|
}
|
|||
|
}
|
|||
|
$returnstring = nl2br($returnstring);
|
|||
|
break;
|
|||
|
|
|||
|
default:
|
|||
|
require_once(GETID3_INCLUDEPATH.'getid3.getimagesize.php');
|
|||
|
$imageinfo = array();
|
|||
|
$imagechunkcheck = GetDataImageSize(substr($variable, 0, 32768), $imageinfo);
|
|||
|
|
|||
|
if (($imagechunkcheck[2] >= 1) && ($imagechunkcheck[2] <= 3)) {
|
|||
|
$returnstring .= '<table border="1" cellspacing="0" cellpadding="2">';
|
|||
|
$returnstring .= '<tr><td><b>type</b></td><td>'.ImageTypesLookup($imagechunkcheck[2]).'</td></tr>';
|
|||
|
$returnstring .= '<tr><td><b>width</b></td><td>'.number_format($imagechunkcheck[0]).' px</td></tr>';
|
|||
|
$returnstring .= '<tr><td><b>height</b></td><td>'.number_format($imagechunkcheck[1]).' px</td></tr>';
|
|||
|
$returnstring .= '<tr><td><b>size</b></td><td>'.number_format(strlen($variable)).' bytes</td></tr></table>';
|
|||
|
} else {
|
|||
|
$returnstring .= nl2br(htmlspecialchars(str_replace(chr(0), ' ', $variable)));
|
|||
|
}
|
|||
|
break;
|
|||
|
}
|
|||
|
return $returnstring;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('string_var_dump')) {
|
|||
|
function string_var_dump($variable) {
|
|||
|
if (version_compare(PHP_VERSION, '4.3.0', '>=')) {
|
|||
|
return print_r($variable, true);
|
|||
|
}
|
|||
|
ob_start();
|
|||
|
var_dump($variable);
|
|||
|
$dumpedvariable = ob_get_contents();
|
|||
|
ob_end_clean();
|
|||
|
return $dumpedvariable;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('fileextension')) {
|
|||
|
function fileextension($filename, $numextensions=1) {
|
|||
|
if (strstr($filename, '.')) {
|
|||
|
$reversedfilename = strrev($filename);
|
|||
|
$offset = 0;
|
|||
|
for ($i = 0; $i < $numextensions; $i++) {
|
|||
|
$offset = strpos($reversedfilename, '.', $offset + 1);
|
|||
|
if ($offset === false) {
|
|||
|
return '';
|
|||
|
}
|
|||
|
}
|
|||
|
return strrev(substr($reversedfilename, 0, $offset));
|
|||
|
}
|
|||
|
return '';
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('RemoveAccents')) {
|
|||
|
function RemoveAccents($string) {
|
|||
|
// return strtr($string, '¥µÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿ', 'SOZsozYYuAAAAAAACEEEEIIIIDNOOOOOOUUUUYsaaaaaaaceeeeiiiionoooooouuuuyy');
|
|||
|
// Revised version by marksteward@hotmail.com
|
|||
|
return strtr(strtr($string, 'ÀÁÂÃÄÅÇÈÉÊËÌÍÎÏÑÒÓÔÕÖØÙÚÛÜÝàáâãäåçèéêëìíîïñòóôõöøùúûüýÿ', 'SZszYAAAAAACEEEEIIIINOOOOOOUUUUYaaaaaaceeeeiiiinoooooouuuuyy'), array('Þ' => 'TH', 'þ' => 'th', 'Ð' => 'DH', 'ð' => 'dh', 'ß' => 'ss', '' => 'OE', '' => 'oe', 'Æ' => 'AE', 'æ' => 'ae', 'µ' => 'u'));
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('MoreNaturalSort')) {
|
|||
|
function MoreNaturalSort($ar1, $ar2) {
|
|||
|
if ($ar1 === $ar2) {
|
|||
|
return 0;
|
|||
|
}
|
|||
|
$len1 = strlen($ar1);
|
|||
|
$len2 = strlen($ar2);
|
|||
|
$shortest = min($len1, $len2);
|
|||
|
if (substr($ar1, 0, $shortest) === substr($ar2, 0, $shortest)) {
|
|||
|
// the shorter argument is the beginning of the longer one, like "str" and "string"
|
|||
|
if ($len1 < $len2) {
|
|||
|
return -1;
|
|||
|
} elseif ($len1 > $len2) {
|
|||
|
return 1;
|
|||
|
}
|
|||
|
return 0;
|
|||
|
}
|
|||
|
$ar1 = RemoveAccents(strtolower(trim($ar1)));
|
|||
|
$ar2 = RemoveAccents(strtolower(trim($ar2)));
|
|||
|
$translatearray = array('\''=>'', '"'=>'', '_'=>' ', '('=>'', ')'=>'', '-'=>' ', ' '=>' ', '.'=>'', ','=>'');
|
|||
|
foreach ($translatearray as $key => $val) {
|
|||
|
$ar1 = str_replace($key, $val, $ar1);
|
|||
|
$ar2 = str_replace($key, $val, $ar2);
|
|||
|
}
|
|||
|
|
|||
|
if ($ar1 < $ar2) {
|
|||
|
return -1;
|
|||
|
} elseif ($ar1 > $ar2) {
|
|||
|
return 1;
|
|||
|
}
|
|||
|
return 0;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('trunc')) {
|
|||
|
function trunc($floatnumber) {
|
|||
|
// truncates a floating-point number at the decimal point
|
|||
|
// returns int (if possible, otherwise float)
|
|||
|
if ($floatnumber >= 1) {
|
|||
|
$truncatednumber = floor($floatnumber);
|
|||
|
} elseif ($floatnumber <= -1) {
|
|||
|
$truncatednumber = ceil($floatnumber);
|
|||
|
} else {
|
|||
|
$truncatednumber = 0;
|
|||
|
}
|
|||
|
if ($truncatednumber <= pow(2, 30)) {
|
|||
|
$truncatednumber = (int) $truncatednumber;
|
|||
|
}
|
|||
|
return $truncatednumber;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('CastAsInt')) {
|
|||
|
function CastAsInt($floatnum) {
|
|||
|
// convert to float if not already
|
|||
|
$floatnum = (float) $floatnum;
|
|||
|
|
|||
|
// convert a float to type int, only if possible
|
|||
|
if (trunc($floatnum) == $floatnum) {
|
|||
|
// it's not floating point
|
|||
|
if ($floatnum <= pow(2, 30)) {
|
|||
|
// it's within int range
|
|||
|
$floatnum = (int) $floatnum;
|
|||
|
}
|
|||
|
}
|
|||
|
return $floatnum;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('getmicrotime')) {
|
|||
|
function getmicrotime() {
|
|||
|
list($usec, $sec) = explode(' ', microtime());
|
|||
|
return ((float) $usec + (float) $sec);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('DecimalBinary2Float')) {
|
|||
|
function DecimalBinary2Float($binarynumerator) {
|
|||
|
$numerator = Bin2Dec($binarynumerator);
|
|||
|
$denominator = Bin2Dec(str_repeat('1', strlen($binarynumerator)));
|
|||
|
return ($numerator / $denominator);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('NormalizeBinaryPoint')) {
|
|||
|
function NormalizeBinaryPoint($binarypointnumber, $maxbits=52) {
|
|||
|
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/binary.html
|
|||
|
if (strpos($binarypointnumber, '.') === false) {
|
|||
|
$binarypointnumber = '0.'.$binarypointnumber;
|
|||
|
} elseif ($binarypointnumber{0} == '.') {
|
|||
|
$binarypointnumber = '0'.$binarypointnumber;
|
|||
|
}
|
|||
|
$exponent = 0;
|
|||
|
while (($binarypointnumber{0} != '1') || (substr($binarypointnumber, 1, 1) != '.')) {
|
|||
|
if (substr($binarypointnumber, 1, 1) == '.') {
|
|||
|
$exponent--;
|
|||
|
$binarypointnumber = substr($binarypointnumber, 2, 1).'.'.substr($binarypointnumber, 3);
|
|||
|
} else {
|
|||
|
$pointpos = strpos($binarypointnumber, '.');
|
|||
|
$exponent += ($pointpos - 1);
|
|||
|
$binarypointnumber = str_replace('.', '', $binarypointnumber);
|
|||
|
$binarypointnumber = $binarypointnumber{0}.'.'.substr($binarypointnumber, 1);
|
|||
|
}
|
|||
|
}
|
|||
|
$binarypointnumber = str_pad(substr($binarypointnumber, 0, $maxbits + 2), $maxbits + 2, '0', STR_PAD_RIGHT);
|
|||
|
return array('normalized'=>$binarypointnumber, 'exponent'=>(int) $exponent);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('Float2BinaryDecimal')) {
|
|||
|
function Float2BinaryDecimal($floatvalue) {
|
|||
|
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/binary.html
|
|||
|
$maxbits = 128; // to how many bits of precision should the calculations be taken?
|
|||
|
$intpart = trunc($floatvalue);
|
|||
|
$floatpart = abs($floatvalue - $intpart);
|
|||
|
$pointbitstring = '';
|
|||
|
while (($floatpart != 0) && (strlen($pointbitstring) < $maxbits)) {
|
|||
|
$floatpart *= 2;
|
|||
|
$pointbitstring .= (string) trunc($floatpart);
|
|||
|
$floatpart -= trunc($floatpart);
|
|||
|
}
|
|||
|
$binarypointnumber = decbin($intpart).'.'.$pointbitstring;
|
|||
|
return $binarypointnumber;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('Float2String')) {
|
|||
|
function Float2String($floatvalue, $bits) {
|
|||
|
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/ieee-expl.html
|
|||
|
switch ($bits) {
|
|||
|
case 32:
|
|||
|
$exponentbits = 8;
|
|||
|
$fractionbits = 23;
|
|||
|
break;
|
|||
|
|
|||
|
case 64:
|
|||
|
$exponentbits = 11;
|
|||
|
$fractionbits = 52;
|
|||
|
break;
|
|||
|
|
|||
|
default:
|
|||
|
return false;
|
|||
|
break;
|
|||
|
}
|
|||
|
if ($floatvalue >= 0) {
|
|||
|
$signbit = '0';
|
|||
|
} else {
|
|||
|
$signbit = '1';
|
|||
|
}
|
|||
|
$normalizedbinary = NormalizeBinaryPoint(Float2BinaryDecimal($floatvalue), $fractionbits);
|
|||
|
$biasedexponent = pow(2, $exponentbits - 1) - 1 + $normalizedbinary['exponent']; // (127 or 1023) +/- exponent
|
|||
|
$exponentbitstring = str_pad(decbin($biasedexponent), $exponentbits, '0', STR_PAD_LEFT);
|
|||
|
$fractionbitstring = str_pad(substr($normalizedbinary['normalized'], 2), $fractionbits, '0', STR_PAD_RIGHT);
|
|||
|
|
|||
|
return BigEndian2String(Bin2Dec($signbit.$exponentbitstring.$fractionbitstring), $bits % 8, false);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('LittleEndian2Float')) {
|
|||
|
function LittleEndian2Float($byteword) {
|
|||
|
return BigEndian2Float(strrev($byteword));
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('BigEndian2Float')) {
|
|||
|
function BigEndian2Float($byteword) {
|
|||
|
// ANSI/IEEE Standard 754-1985, Standard for Binary Floating Point Arithmetic
|
|||
|
// http://www.psc.edu/general/software/packages/ieee/ieee.html
|
|||
|
// http://www.scri.fsu.edu/~jac/MAD3401/Backgrnd/ieee.html
|
|||
|
|
|||
|
$bitword = BigEndian2Bin($byteword);
|
|||
|
$signbit = $bitword{0};
|
|||
|
|
|||
|
switch (strlen($byteword) * 8) {
|
|||
|
case 32:
|
|||
|
$exponentbits = 8;
|
|||
|
$fractionbits = 23;
|
|||
|
break;
|
|||
|
|
|||
|
case 64:
|
|||
|
$exponentbits = 11;
|
|||
|
$fractionbits = 52;
|
|||
|
break;
|
|||
|
|
|||
|
case 80:
|
|||
|
$exponentbits = 16;
|
|||
|
$fractionbits = 64;
|
|||
|
break;
|
|||
|
|
|||
|
default:
|
|||
|
return false;
|
|||
|
break;
|
|||
|
}
|
|||
|
$exponentstring = substr($bitword, 1, $exponentbits - 1);
|
|||
|
$fractionstring = substr($bitword, $exponentbits, $fractionbits);
|
|||
|
$exponent = Bin2Dec($exponentstring);
|
|||
|
$fraction = Bin2Dec($fractionstring);
|
|||
|
|
|||
|
if (($exponentbits == 16) && ($fractionbits == 64)) {
|
|||
|
// 80-bit
|
|||
|
// As used in Apple AIFF for sample_rate
|
|||
|
// A bit of a hack, but it works ;)
|
|||
|
return pow(2, ($exponent - 16382)) * DecimalBinary2Float($fractionstring);
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
if (($exponent == (pow(2, $exponentbits) - 1)) && ($fraction != 0)) {
|
|||
|
// Not a Number
|
|||
|
$floatvalue = false;
|
|||
|
} elseif (($exponent == (pow(2, $exponentbits) - 1)) && ($fraction == 0)) {
|
|||
|
if ($signbit == '1') {
|
|||
|
$floatvalue = '-infinity';
|
|||
|
} else {
|
|||
|
$floatvalue = '+infinity';
|
|||
|
}
|
|||
|
} elseif (($exponent == 0) && ($fraction == 0)) {
|
|||
|
if ($signbit == '1') {
|
|||
|
$floatvalue = -0;
|
|||
|
} else {
|
|||
|
$floatvalue = 0;
|
|||
|
}
|
|||
|
$floatvalue = ($signbit ? 0 : -0);
|
|||
|
} elseif (($exponent == 0) && ($fraction != 0)) {
|
|||
|
// These are 'unnormalized' values
|
|||
|
$floatvalue = pow(2, (-1 * (pow(2, $exponentbits - 1) - 2))) * DecimalBinary2Float($fractionstring);
|
|||
|
if ($signbit == '1') {
|
|||
|
$floatvalue *= -1;
|
|||
|
}
|
|||
|
} elseif ($exponent != 0) {
|
|||
|
$floatvalue = pow(2, ($exponent - (pow(2, $exponentbits - 1) - 1))) * (1 + DecimalBinary2Float($fractionstring));
|
|||
|
if ($signbit == '1') {
|
|||
|
$floatvalue *= -1;
|
|||
|
}
|
|||
|
}
|
|||
|
return (float) $floatvalue;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('BigEndian2Int')) {
|
|||
|
function BigEndian2Int($byteword, $synchsafe=false, $signed=false) {
|
|||
|
$intvalue = 0;
|
|||
|
$bytewordlen = strlen($byteword);
|
|||
|
for ($i = 0; $i < $bytewordlen; $i++) {
|
|||
|
if ($synchsafe) { // disregard MSB, effectively 7-bit bytes
|
|||
|
$intvalue = $intvalue | (ord($byteword{$i}) & 0x7F) << (($bytewordlen - 1 - $i) * 7);
|
|||
|
} else {
|
|||
|
$intvalue += ord($byteword{$i}) * pow(256, ($bytewordlen - 1 - $i));
|
|||
|
}
|
|||
|
}
|
|||
|
if ($signed && !$synchsafe) {
|
|||
|
// synchsafe ints are not allowed to be signed
|
|||
|
switch ($bytewordlen) {
|
|||
|
case 1:
|
|||
|
case 2:
|
|||
|
case 3:
|
|||
|
case 4:
|
|||
|
$signmaskbit = 0x80 << (8 * ($bytewordlen - 1));
|
|||
|
if ($intvalue & $signmaskbit) {
|
|||
|
$intvalue = 0 - ($intvalue & ($signmaskbit - 1));
|
|||
|
}
|
|||
|
break;
|
|||
|
|
|||
|
default:
|
|||
|
die('ERROR: Cannot have signed integers larger than 32-bits in BigEndian2Int()');
|
|||
|
break;
|
|||
|
}
|
|||
|
}
|
|||
|
return CastAsInt($intvalue);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('LittleEndian2Int')) {
|
|||
|
function LittleEndian2Int($byteword, $signed=false) {
|
|||
|
return BigEndian2Int(strrev($byteword), false, $signed);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('BigEndian2Bin')) {
|
|||
|
function BigEndian2Bin($byteword) {
|
|||
|
$binvalue = '';
|
|||
|
$bytewordlen = strlen($byteword);
|
|||
|
for ($i = 0; $i < $bytewordlen; $i++) {
|
|||
|
$binvalue .= str_pad(decbin(ord($byteword{$i})), 8, '0', STR_PAD_LEFT);
|
|||
|
}
|
|||
|
return $binvalue;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('BigEndian2String')) {
|
|||
|
function BigEndian2String($number, $minbytes=1, $synchsafe=false, $signed=false) {
|
|||
|
if ($number < 0) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
$maskbyte = (($synchsafe || $signed) ? 0x7F : 0xFF);
|
|||
|
$intstring = '';
|
|||
|
if ($signed) {
|
|||
|
if ($minbytes > 4) {
|
|||
|
die('ERROR: Cannot have signed integers larger than 32-bits in BigEndian2String()');
|
|||
|
}
|
|||
|
$number = $number & (0x80 << (8 * ($minbytes - 1)));
|
|||
|
}
|
|||
|
while ($number != 0) {
|
|||
|
$quotient = ($number / ($maskbyte + 1));
|
|||
|
$intstring = chr(ceil(($quotient - floor($quotient)) * $maskbyte)).$intstring;
|
|||
|
$number = floor($quotient);
|
|||
|
}
|
|||
|
return str_pad($intstring, $minbytes, chr(0), STR_PAD_LEFT);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('Dec2Bin')) {
|
|||
|
function Dec2Bin($number) {
|
|||
|
while ($number >= 256) {
|
|||
|
$bytes[] = (($number / 256) - (floor($number / 256))) * 256;
|
|||
|
$number = floor($number / 256);
|
|||
|
}
|
|||
|
$bytes[] = $number;
|
|||
|
$binstring = '';
|
|||
|
for ($i = 0; $i < count($bytes); $i++) {
|
|||
|
$binstring = (($i == count($bytes) - 1) ? decbin($bytes[$i]) : str_pad(decbin($bytes[$i]), 8, '0', STR_PAD_LEFT)).$binstring;
|
|||
|
}
|
|||
|
return $binstring;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('Bin2Dec')) {
|
|||
|
function Bin2Dec($binstring) {
|
|||
|
$decvalue = 0;
|
|||
|
for ($i = 0; $i < strlen($binstring); $i++) {
|
|||
|
$decvalue += ((int) substr($binstring, strlen($binstring) - $i - 1, 1)) * pow(2, $i);
|
|||
|
}
|
|||
|
return CastAsInt($decvalue);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('Bin2String')) {
|
|||
|
function Bin2String($binstring) {
|
|||
|
// return 'hi' for input of '0110100001101001'
|
|||
|
$string = '';
|
|||
|
$binstringreversed = strrev($binstring);
|
|||
|
for ($i = 0; $i < strlen($binstringreversed); $i += 8) {
|
|||
|
$string = chr(Bin2Dec(strrev(substr($binstringreversed, $i, 8)))).$string;
|
|||
|
}
|
|||
|
return $string;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('LittleEndian2String')) {
|
|||
|
function LittleEndian2String($number, $minbytes=1, $synchsafe=false) {
|
|||
|
$intstring = '';
|
|||
|
while ($number > 0) {
|
|||
|
if ($synchsafe) {
|
|||
|
$intstring = $intstring.chr($number & 127);
|
|||
|
$number >>= 7;
|
|||
|
} else {
|
|||
|
$intstring = $intstring.chr($number & 255);
|
|||
|
$number >>= 8;
|
|||
|
}
|
|||
|
}
|
|||
|
return str_pad($intstring, $minbytes, chr(0), STR_PAD_RIGHT);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('Bool2IntString')) {
|
|||
|
function Bool2IntString($intvalue) {
|
|||
|
return ($intvalue ? '1' : '0');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('IntString2Bool')) {
|
|||
|
function IntString2Bool($char) {
|
|||
|
if ($char == '1') {
|
|||
|
return true;
|
|||
|
} elseif ($char == '0') {
|
|||
|
return false;
|
|||
|
}
|
|||
|
return null;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('InverseBoolean')) {
|
|||
|
function InverseBoolean($value) {
|
|||
|
return ($value ? false : true);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('DeUnSynchronise')) {
|
|||
|
function DeUnSynchronise($data) {
|
|||
|
return str_replace(chr(0xFF).chr(0x00), chr(0xFF), $data);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('Unsynchronise')) {
|
|||
|
function Unsynchronise($data) {
|
|||
|
// Whenever a false synchronisation is found within the tag, one zeroed
|
|||
|
// byte is inserted after the first false synchronisation byte. The
|
|||
|
// format of a correct sync that should be altered by ID3 encoders is as
|
|||
|
// follows:
|
|||
|
// %11111111 111xxxxx
|
|||
|
// And should be replaced with:
|
|||
|
// %11111111 00000000 111xxxxx
|
|||
|
// This has the side effect that all $FF 00 combinations have to be
|
|||
|
// altered, so they won't be affected by the decoding process. Therefore
|
|||
|
// all the $FF 00 combinations have to be replaced with the $FF 00 00
|
|||
|
// combination during the unsynchronisation.
|
|||
|
|
|||
|
$data = str_replace(chr(0xFF).chr(0x00), chr(0xFF).chr(0x00).chr(0x00), $data);
|
|||
|
$unsyncheddata = '';
|
|||
|
for ($i = 0; $i < strlen($data); $i++) {
|
|||
|
$thischar = $data{$i};
|
|||
|
$unsyncheddata .= $thischar;
|
|||
|
if ($thischar == chr(255)) {
|
|||
|
$nextchar = ord(substr($data, $i + 1, 1));
|
|||
|
if (($nextchar | 0xE0) == 0xE0) {
|
|||
|
// previous byte = 11111111, this byte = 111?????
|
|||
|
$unsyncheddata .= chr(0);
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
return $unsyncheddata;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('is_hash')) {
|
|||
|
function is_hash($var) {
|
|||
|
// written by dev-null@christophe.vg
|
|||
|
// taken from http://www.php.net/manual/en/function.array-merge-recursive.php
|
|||
|
if (is_array($var)) {
|
|||
|
$keys = array_keys($var);
|
|||
|
$all_num = true;
|
|||
|
for ($i = 0; $i < count($keys); $i++) {
|
|||
|
if (is_string($keys[$i])) {
|
|||
|
return true;
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('array_join_merge')) {
|
|||
|
function array_join_merge($arr1, $arr2) {
|
|||
|
// written by dev-null@christophe.vg
|
|||
|
// taken from http://www.php.net/manual/en/function.array-merge-recursive.php
|
|||
|
if (is_array($arr1) && is_array($arr2)) {
|
|||
|
// the same -> merge
|
|||
|
$new_array = array();
|
|||
|
|
|||
|
if (is_hash($arr1) && is_hash($arr2)) {
|
|||
|
// hashes -> merge based on keys
|
|||
|
$keys = array_merge(array_keys($arr1), array_keys($arr2));
|
|||
|
foreach ($keys as $key) {
|
|||
|
$arr1[$key] = (isset($arr1[$key]) ? $arr1[$key] : '');
|
|||
|
$arr2[$key] = (isset($arr2[$key]) ? $arr2[$key] : '');
|
|||
|
$new_array[$key] = array_join_merge($arr1[$key], $arr2[$key]);
|
|||
|
}
|
|||
|
} else {
|
|||
|
// two real arrays -> merge
|
|||
|
$new_array = array_reverse(array_unique(array_reverse(array_merge($arr1,$arr2))));
|
|||
|
}
|
|||
|
return $new_array;
|
|||
|
} else {
|
|||
|
// not the same ... take new one if defined, else the old one stays
|
|||
|
return $arr2 ? $arr2 : $arr1;
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('array_merge_clobber')) {
|
|||
|
function array_merge_clobber($array1, $array2) {
|
|||
|
// written by kc@hireability.com
|
|||
|
// taken from http://www.php.net/manual/en/function.array-merge-recursive.php
|
|||
|
if (!is_array($array1) || !is_array($array2)) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
$newarray = $array1;
|
|||
|
foreach ($array2 as $key => $val) {
|
|||
|
if (is_array($val) && isset($newarray[$key]) && is_array($newarray[$key])) {
|
|||
|
$newarray[$key] = array_merge_clobber($newarray[$key], $val);
|
|||
|
} else {
|
|||
|
$newarray[$key] = $val;
|
|||
|
}
|
|||
|
}
|
|||
|
return $newarray;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('array_merge_noclobber')) {
|
|||
|
function array_merge_noclobber($array1, $array2) {
|
|||
|
if (!is_array($array1) || !is_array($array2)) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
$newarray = $array1;
|
|||
|
foreach ($array2 as $key => $val) {
|
|||
|
if (is_array($val) && isset($newarray[$key]) && is_array($newarray[$key])) {
|
|||
|
$newarray[$key] = array_merge_noclobber($newarray[$key], $val);
|
|||
|
} elseif (!isset($newarray[$key])) {
|
|||
|
$newarray[$key] = $val;
|
|||
|
}
|
|||
|
}
|
|||
|
return $newarray;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('RoughTranslateUnicodeToASCII')) {
|
|||
|
function RoughTranslateUnicodeToASCII($rawdata, $frame_textencoding) {
|
|||
|
// rough translation of data for application that can't handle Unicode data
|
|||
|
|
|||
|
$tempstring = '';
|
|||
|
switch ($frame_textencoding) {
|
|||
|
case 0: // ISO-8859-1. Terminated with $00.
|
|||
|
$asciidata = $rawdata;
|
|||
|
break;
|
|||
|
|
|||
|
case 1: // UTF-16 encoded Unicode with BOM. Terminated with $00 00.
|
|||
|
$asciidata = $rawdata;
|
|||
|
if (substr($asciidata, 0, 2) == chr(0xFF).chr(0xFE)) {
|
|||
|
// remove BOM, only if present (it should be, but...)
|
|||
|
$asciidata = substr($asciidata, 2);
|
|||
|
}
|
|||
|
if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) {
|
|||
|
$asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...)
|
|||
|
}
|
|||
|
for ($i = 0; $i < strlen($asciidata); $i += 2) {
|
|||
|
if ((ord($asciidata{$i}) <= 0x7F) || (ord($asciidata{$i}) >= 0xA0)) {
|
|||
|
$tempstring .= $asciidata{$i};
|
|||
|
} else {
|
|||
|
$tempstring .= '?';
|
|||
|
}
|
|||
|
}
|
|||
|
$asciidata = $tempstring;
|
|||
|
break;
|
|||
|
|
|||
|
case 2: // UTF-16BE encoded Unicode without BOM. Terminated with $00 00.
|
|||
|
$asciidata = $rawdata;
|
|||
|
if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) {
|
|||
|
$asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...)
|
|||
|
}
|
|||
|
for ($i = 0; $i < strlen($asciidata); $i += 2) {
|
|||
|
if ((ord($asciidata{$i}) <= 0x7F) || (ord($asciidata{$i}) >= 0xA0)) {
|
|||
|
$tempstring .= $asciidata{$i};
|
|||
|
} else {
|
|||
|
$tempstring .= '?';
|
|||
|
}
|
|||
|
}
|
|||
|
$asciidata = $tempstring;
|
|||
|
break;
|
|||
|
|
|||
|
case 3: // UTF-8 encoded Unicode. Terminated with $00.
|
|||
|
$asciidata = utf8_decode($rawdata);
|
|||
|
break;
|
|||
|
|
|||
|
case 255: // Unicode, Big-Endian. Terminated with $00 00.
|
|||
|
$asciidata = $rawdata;
|
|||
|
if (substr($asciidata, strlen($asciidata) - 2, 2) == chr(0).chr(0)) {
|
|||
|
$asciidata = substr($asciidata, 0, strlen($asciidata) - 2); // remove terminator, only if present (it should be, but...)
|
|||
|
}
|
|||
|
for ($i = 0; ($i + 1) < strlen($asciidata); $i += 2) {
|
|||
|
if ((ord($asciidata{($i + 1)}) <= 0x7F) || (ord($asciidata{($i + 1)}) >= 0xA0)) {
|
|||
|
$tempstring .= $asciidata{($i + 1)};
|
|||
|
} else {
|
|||
|
$tempstring .= '?';
|
|||
|
}
|
|||
|
}
|
|||
|
$asciidata = $tempstring;
|
|||
|
break;
|
|||
|
|
|||
|
|
|||
|
default:
|
|||
|
// shouldn't happen, but in case $frame_textencoding is not 1 <= $frame_textencoding <= 4
|
|||
|
// just pass the data through unchanged.
|
|||
|
$asciidata = $rawdata;
|
|||
|
break;
|
|||
|
}
|
|||
|
if (substr($asciidata, strlen($asciidata) - 1, 1) == chr(0)) {
|
|||
|
// remove null terminator, if present
|
|||
|
$asciidata = NoNullString($asciidata);
|
|||
|
}
|
|||
|
return $asciidata;
|
|||
|
// return str_replace(chr(0), '', $asciidata); // just in case any nulls slipped through
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('PlaytimeString')) {
|
|||
|
function PlaytimeString($playtimeseconds) {
|
|||
|
$contentseconds = round((($playtimeseconds / 60) - floor($playtimeseconds / 60)) * 60);
|
|||
|
$contentminutes = floor($playtimeseconds / 60);
|
|||
|
if ($contentseconds >= 60) {
|
|||
|
$contentseconds -= 60;
|
|||
|
$contentminutes++;
|
|||
|
}
|
|||
|
return number_format($contentminutes).':'.str_pad($contentseconds, 2, 0, STR_PAD_LEFT);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('CloseMatch')) {
|
|||
|
function CloseMatch($value1, $value2, $tolerance) {
|
|||
|
return (abs($value1 - $value2) <= $tolerance);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('ID3v1matchesID3v2')) {
|
|||
|
function ID3v1matchesID3v2($id3v1, $id3v2) {
|
|||
|
|
|||
|
$requiredindices = array('title', 'artist', 'album', 'year', 'genre', 'comment');
|
|||
|
foreach ($requiredindices as $requiredindex) {
|
|||
|
if (!isset($id3v1["$requiredindex"])) {
|
|||
|
$id3v1["$requiredindex"] = '';
|
|||
|
}
|
|||
|
if (!isset($id3v2["$requiredindex"])) {
|
|||
|
$id3v2["$requiredindex"] = '';
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (trim($id3v1['title']) != trim(substr($id3v2['title'], 0, 30))) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (trim($id3v1['artist']) != trim(substr($id3v2['artist'], 0, 30))) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (trim($id3v1['album']) != trim(substr($id3v2['album'], 0, 30))) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (trim($id3v1['year']) != trim(substr($id3v2['year'], 0, 4))) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (trim($id3v1['genre']) != trim($id3v2['genre'])) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (isset($id3v1['track'])) {
|
|||
|
if (!isset($id3v1['track']) || (trim($id3v1['track']) != trim($id3v2['track']))) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (trim($id3v1['comment']) != trim(substr($id3v2['comment'], 0, 28))) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
} else {
|
|||
|
if (trim($id3v1['comment']) != trim(substr($id3v2['comment'], 0, 30))) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
return true;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('FILETIMEtoUNIXtime')) {
|
|||
|
function FILETIMEtoUNIXtime($FILETIME, $round=true) {
|
|||
|
// FILETIME is a 64-bit unsigned integer representing
|
|||
|
// the number of 100-nanosecond intervals since January 1, 1601
|
|||
|
// UNIX timestamp is number of seconds since January 1, 1970
|
|||
|
// 116444736000000000 = 10000000 * 60 * 60 * 24 * 365 * 369 + 89 leap days
|
|||
|
if ($round) {
|
|||
|
return round(($FILETIME - 116444736000000000) / 10000000);
|
|||
|
}
|
|||
|
return ($FILETIME - 116444736000000000) / 10000000;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('GUIDtoBytestring')) {
|
|||
|
function GUIDtoBytestring($GUIDstring) {
|
|||
|
// Microsoft defines these 16-byte (128-bit) GUIDs in the strangest way:
|
|||
|
// first 4 bytes are in little-endian order
|
|||
|
// next 2 bytes are appended in little-endian order
|
|||
|
// next 2 bytes are appended in little-endian order
|
|||
|
// next 2 bytes are appended in big-endian order
|
|||
|
// next 6 bytes are appended in big-endian order
|
|||
|
|
|||
|
// AaBbCcDd-EeFf-GgHh-IiJj-KkLlMmNnOoPp is stored as this 16-byte string:
|
|||
|
// $Dd $Cc $Bb $Aa $Ff $Ee $Hh $Gg $Ii $Jj $Kk $Ll $Mm $Nn $Oo $Pp
|
|||
|
|
|||
|
$hexbytecharstring = chr(hexdec(substr($GUIDstring, 6, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 4, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 2, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 0, 2)));
|
|||
|
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 11, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 9, 2)));
|
|||
|
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 16, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 14, 2)));
|
|||
|
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 19, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 21, 2)));
|
|||
|
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 24, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 26, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 28, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 30, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 32, 2)));
|
|||
|
$hexbytecharstring .= chr(hexdec(substr($GUIDstring, 34, 2)));
|
|||
|
|
|||
|
return $hexbytecharstring;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('BytestringToGUID')) {
|
|||
|
function BytestringToGUID($Bytestring) {
|
|||
|
$GUIDstring = str_pad(dechex(ord($Bytestring{3})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{2})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{1})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{0})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= '-';
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{5})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{4})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= '-';
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{7})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{6})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= '-';
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{8})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{9})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= '-';
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{10})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{11})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{12})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{13})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{14})), 2, '0', STR_PAD_LEFT);
|
|||
|
$GUIDstring .= str_pad(dechex(ord($Bytestring{15})), 2, '0', STR_PAD_LEFT);
|
|||
|
|
|||
|
return strtoupper($GUIDstring);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('BitrateColor')) {
|
|||
|
function BitrateColor($bitrate) {
|
|||
|
$bitrate /= 3; // scale from 1-768kbps to 1-256kbps
|
|||
|
$bitrate--; // scale from 1-256kbps to 0-255kbps
|
|||
|
$bitrate = max($bitrate, 0);
|
|||
|
$bitrate = min($bitrate, 255);
|
|||
|
//$bitrate = max($bitrate, 32);
|
|||
|
//$bitrate = min($bitrate, 143);
|
|||
|
//$bitrate = ($bitrate * 2) - 32;
|
|||
|
|
|||
|
$Rcomponent = max(255 - ($bitrate * 2), 0);
|
|||
|
$Gcomponent = max(($bitrate * 2) - 255, 0);
|
|||
|
if ($bitrate > 127) {
|
|||
|
$Bcomponent = max((255 - $bitrate) * 2, 0);
|
|||
|
} else {
|
|||
|
$Bcomponent = max($bitrate * 2, 0);
|
|||
|
}
|
|||
|
return str_pad(dechex($Rcomponent), 2, '0', STR_PAD_LEFT).str_pad(dechex($Gcomponent), 2, '0', STR_PAD_LEFT).str_pad(dechex($Bcomponent), 2, '0', STR_PAD_LEFT);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('BitrateText')) {
|
|||
|
function BitrateText($bitrate) {
|
|||
|
return '<SPAN STYLE="color: #'.BitrateColor($bitrate).'">'.round($bitrate).' kbps</SPAN>';
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('image_type_to_mime_type')) {
|
|||
|
function image_type_to_mime_type($imagetypeid) {
|
|||
|
// only available in PHP v4.3.0+
|
|||
|
static $image_type_to_mime_type = array();
|
|||
|
if (empty($image_type_to_mime_type)) {
|
|||
|
$image_type_to_mime_type[1] = 'image/gif'; // GIF
|
|||
|
$image_type_to_mime_type[2] = 'image/jpeg'; // JPEG
|
|||
|
$image_type_to_mime_type[3] = 'image/png'; // PNG
|
|||
|
$image_type_to_mime_type[4] = 'application/x-shockwave-flash'; // Flash
|
|||
|
$image_type_to_mime_type[5] = 'image/psd'; // PSD
|
|||
|
$image_type_to_mime_type[6] = 'image/bmp'; // BMP
|
|||
|
$image_type_to_mime_type[7] = 'image/tiff'; // TIFF: little-endian (Intel)
|
|||
|
$image_type_to_mime_type[8] = 'image/tiff'; // TIFF: big-endian (Motorola)
|
|||
|
//$image_type_to_mime_type[9] = 'image/jpc'; // JPC
|
|||
|
//$image_type_to_mime_type[10] = 'image/jp2'; // JPC
|
|||
|
//$image_type_to_mime_type[11] = 'image/jpx'; // JPC
|
|||
|
//$image_type_to_mime_type[12] = 'image/jb2'; // JPC
|
|||
|
$image_type_to_mime_type[13] = 'application/x-shockwave-flash'; // Shockwave
|
|||
|
$image_type_to_mime_type[14] = 'image/iff'; // IFF
|
|||
|
}
|
|||
|
return (isset($image_type_to_mime_type[$imagetypeid]) ? $image_type_to_mime_type[$imagetypeid] : 'application/octet-stream');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('utf8_decode')) {
|
|||
|
// PHP has this function built-in if it's configured with the --with-xml option
|
|||
|
// This version of the function is only provided in case XML isn't installed
|
|||
|
function utf8_decode($utf8text) {
|
|||
|
// http://www.php.net/manual/en/function.utf8-encode.php
|
|||
|
// bytes bits representation
|
|||
|
// 1 7 0bbbbbbb
|
|||
|
// 2 11 110bbbbb 10bbbbbb
|
|||
|
// 3 16 1110bbbb 10bbbbbb 10bbbbbb
|
|||
|
// 4 21 11110bbb 10bbbbbb 10bbbbbb 10bbbbbb
|
|||
|
|
|||
|
$utf8length = strlen($utf8text);
|
|||
|
$decodedtext = '';
|
|||
|
for ($i = 0; $i < $utf8length; $i++) {
|
|||
|
if ((ord($utf8text{$i}) & 0x80) == 0) {
|
|||
|
$decodedtext .= $utf8text{$i};
|
|||
|
} elseif ((ord($utf8text{$i}) & 0xF0) == 0xF0) {
|
|||
|
$decodedtext .= '?';
|
|||
|
$i += 3;
|
|||
|
} elseif ((ord($utf8text{$i}) & 0xE0) == 0xE0) {
|
|||
|
$decodedtext .= '?';
|
|||
|
$i += 2;
|
|||
|
} elseif ((ord($utf8text{$i}) & 0xC0) == 0xC0) {
|
|||
|
// 2 11 110bbbbb 10bbbbbb
|
|||
|
$decodedchar = Bin2Dec(substr(Dec2Bin(ord($utf8text{$i})), 3, 5).substr(Dec2Bin(ord($utf8text{($i + 1)})), 2, 6));
|
|||
|
if ($decodedchar <= 255) {
|
|||
|
$decodedtext .= chr($decodedchar);
|
|||
|
} else {
|
|||
|
$decodedtext .= '?';
|
|||
|
}
|
|||
|
$i += 1;
|
|||
|
}
|
|||
|
}
|
|||
|
return $decodedtext;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('DateMac2Unix')) {
|
|||
|
function DateMac2Unix($macdate) {
|
|||
|
// Macintosh timestamp: seconds since 00:00h January 1, 1904
|
|||
|
// UNIX timestamp: seconds since 00:00h January 1, 1970
|
|||
|
return CastAsInt($macdate - 2082844800);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
if (!function_exists('FixedPoint8_8')) {
|
|||
|
function FixedPoint8_8($rawdata) {
|
|||
|
return BigEndian2Int(substr($rawdata, 0, 1)) + (float) (BigEndian2Int(substr($rawdata, 1, 1)) / pow(2, 8));
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
if (!function_exists('FixedPoint16_16')) {
|
|||
|
function FixedPoint16_16($rawdata) {
|
|||
|
return BigEndian2Int(substr($rawdata, 0, 2)) + (float) (BigEndian2Int(substr($rawdata, 2, 2)) / pow(2, 16));
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
if (!function_exists('FixedPoint2_30')) {
|
|||
|
function FixedPoint2_30($rawdata) {
|
|||
|
$binarystring = BigEndian2Bin($rawdata);
|
|||
|
return Bin2Dec(substr($binarystring, 0, 2)) + (float) (Bin2Dec(substr($binarystring, 2, 30)) / pow(2, 30));
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
if (!function_exists('Pascal2String')) {
|
|||
|
function Pascal2String($pascalstring) {
|
|||
|
// Pascal strings have 1 byte at the beginning saying how many chars are in the string
|
|||
|
return substr($pascalstring, 1);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('NoNullString')) {
|
|||
|
function NoNullString($nullterminatedstring) {
|
|||
|
// remove the single null terminator on null terminated strings
|
|||
|
if (substr($nullterminatedstring, strlen($nullterminatedstring) - 1, 1) === chr(0)) {
|
|||
|
return substr($nullterminatedstring, 0, strlen($nullterminatedstring) - 1);
|
|||
|
}
|
|||
|
return $nullterminatedstring;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('FileSizeNiceDisplay')) {
|
|||
|
function FileSizeNiceDisplay($filesize, $precision=2) {
|
|||
|
if ($filesize < 1000) {
|
|||
|
$sizeunit = 'bytes';
|
|||
|
$precision = 0;
|
|||
|
} else {
|
|||
|
$filesize /= 1024;
|
|||
|
$sizeunit = 'kB';
|
|||
|
}
|
|||
|
if ($filesize >= 1000) {
|
|||
|
$filesize /= 1024;
|
|||
|
$sizeunit = 'MB';
|
|||
|
}
|
|||
|
if ($filesize >= 1000) {
|
|||
|
$filesize /= 1024;
|
|||
|
$sizeunit = 'GB';
|
|||
|
}
|
|||
|
return number_format($filesize, $precision).' '.$sizeunit;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('DOStime2UNIXtime')) {
|
|||
|
function DOStime2UNIXtime($DOSdate, $DOStime) {
|
|||
|
// wFatDate
|
|||
|
// Specifies the MS-DOS date. The date is a packed 16-bit value with the following format:
|
|||
|
// Bits Contents
|
|||
|
// 0-4 Day of the month (1-31)
|
|||
|
// 5-8 Month (1 = January, 2 = February, and so on)
|
|||
|
// 9-15 Year offset from 1980 (add 1980 to get actual year)
|
|||
|
|
|||
|
$UNIXday = ($DOSdate & 0x001F);
|
|||
|
$UNIXmonth = (($DOSdate & 0x01E0) >> 5);
|
|||
|
$UNIXyear = (($DOSdate & 0xFE00) >> 9) + 1980;
|
|||
|
|
|||
|
// wFatTime
|
|||
|
// Specifies the MS-DOS time. The time is a packed 16-bit value with the following format:
|
|||
|
// Bits Contents
|
|||
|
// 0-4 Second divided by 2
|
|||
|
// 5-10 Minute (0-59)
|
|||
|
// 11-15 Hour (0-23 on a 24-hour clock)
|
|||
|
|
|||
|
$UNIXsecond = ($DOStime & 0x001F) * 2;
|
|||
|
$UNIXminute = (($DOStime & 0x07E0) >> 5);
|
|||
|
$UNIXhour = (($DOStime & 0xF800) >> 11);
|
|||
|
|
|||
|
return mktime($UNIXhour, $UNIXminute, $UNIXsecond, $UNIXmonth, $UNIXday, $UNIXyear);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('CreateDeepArray')) {
|
|||
|
function CreateDeepArray($ArrayPath, $Separator, $Value) {
|
|||
|
// assigns $Value to a nested array path:
|
|||
|
// $foo = CreateDeepArray('/path/to/my', '/', 'file.txt')
|
|||
|
// is the same as:
|
|||
|
// $foo = array('path'=>array('to'=>'array('my'=>array('file.txt'))));
|
|||
|
// or
|
|||
|
// $foo['path']['to']['my'] = 'file.txt';
|
|||
|
while ($ArrayPath{0} == $Separator) {
|
|||
|
$ArrayPath = substr($ArrayPath, 1);
|
|||
|
}
|
|||
|
if (($pos = strpos($ArrayPath, $Separator)) !== false) {
|
|||
|
$ReturnedArray[substr($ArrayPath, 0, $pos)] = CreateDeepArray(substr($ArrayPath, $pos + 1), $Separator, $Value);
|
|||
|
} else {
|
|||
|
$ReturnedArray["$ArrayPath"] = $Value;
|
|||
|
}
|
|||
|
return $ReturnedArray;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('md5_file')) {
|
|||
|
// Allan Hansen <ah@artemis.dk>
|
|||
|
// md5_file() exists in PHP 4.2.0.
|
|||
|
// The following works under UNIX only, but dies on windows
|
|||
|
function md5_file($file) {
|
|||
|
if (substr(php_uname(), 0, 7) == 'Windows') {
|
|||
|
die('PHP 4.2.0 or newer required for md5_file()');
|
|||
|
}
|
|||
|
|
|||
|
$file = str_replace('`', '\\`', $file);
|
|||
|
if (preg_match("#^([0-9a-f]{32})[ \t\n\r]#i", `md5sum "$file"`, $r)) {
|
|||
|
return $r[1];
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('md5_data')) {
|
|||
|
// Allan Hansen <ah@artemis.dk>
|
|||
|
// md5_data() - returns md5sum for a file from startuing position to absolute end position
|
|||
|
|
|||
|
function md5_data($file, $offset, $end, $invertsign=false) {
|
|||
|
// first try and create a temporary file in the same directory as the file being scanned
|
|||
|
if (($dataMD5filename = tempnam(dirname($file), preg_replace('#[^[:alnum:]]#i', '', basename($file)))) === false) {
|
|||
|
// if that fails, create a temporary file in the system temp directory
|
|||
|
if (($dataMD5filename = tempnam('/tmp', 'getID3')) === false) {
|
|||
|
// if that fails, create a temporary file in the current directory
|
|||
|
if (($dataMD5filename = tempnam('.', preg_replace('#[^[:alnum:]]#i', '', basename($file)))) === false) {
|
|||
|
// can't find anywhere to create a temp file, just die
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
$md5 = false;
|
|||
|
set_time_limit(max(filesize($file) / 1000000, 30));
|
|||
|
|
|||
|
// copy parts of file
|
|||
|
ob_start();
|
|||
|
if ($fp = fopen($file, 'rb')) {
|
|||
|
ob_end_clean();
|
|||
|
|
|||
|
ob_start();
|
|||
|
if ($MD5fp = fopen($dataMD5filename, 'wb')) {
|
|||
|
|
|||
|
ob_end_clean();
|
|||
|
if ($invertsign) {
|
|||
|
// Load conversion lookup strings for 8-bit unsigned->signed conversion below
|
|||
|
$from = '';
|
|||
|
$to = '';
|
|||
|
for ($i = 0; $i < 128; $i++) {
|
|||
|
$from .= chr($i);
|
|||
|
$to .= chr($i + 128);
|
|||
|
}
|
|||
|
for ($i = 128; $i < 256; $i++) {
|
|||
|
$from .= chr($i);
|
|||
|
$to .= chr($i - 128);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
fseek($fp, $offset, SEEK_SET);
|
|||
|
$byteslefttowrite = $end - $offset;
|
|||
|
while (($byteslefttowrite > 0) && ($buffer = fread($fp, 32768))) {
|
|||
|
if ($invertsign) {
|
|||
|
// Possibly FLAC-specific (?)
|
|||
|
// FLAC calculates the MD5sum of the source data of 8-bit files
|
|||
|
// not on the actual byte values in the source file, but of those
|
|||
|
// values converted from unsigned to signed, or more specifcally,
|
|||
|
// with the MSB inverted. ex: 01 -> 81; F5 -> 75; etc
|
|||
|
|
|||
|
// Therefore, 8-bit WAV data has to be converted before getting the
|
|||
|
// md5_data value so as to match the FLAC value
|
|||
|
|
|||
|
// Flip the MSB for each byte in the buffer before copying
|
|||
|
$buffer = strtr($buffer, $from, $to);
|
|||
|
}
|
|||
|
$byteswritten = fwrite($MD5fp, $buffer, $byteslefttowrite);
|
|||
|
$byteslefttowrite -= $byteswritten;
|
|||
|
}
|
|||
|
fclose($MD5fp);
|
|||
|
$md5 = md5_file($dataMD5filename);
|
|||
|
|
|||
|
} else {
|
|||
|
$errormessage = ob_get_contents();
|
|||
|
ob_end_clean();
|
|||
|
}
|
|||
|
fclose($fp);
|
|||
|
|
|||
|
} else {
|
|||
|
$errormessage = ob_get_contents();
|
|||
|
ob_end_clean();
|
|||
|
}
|
|||
|
unlink($dataMD5filename);
|
|||
|
return $md5;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('TwosCompliment2Decimal')) {
|
|||
|
function TwosCompliment2Decimal($BinaryValue) {
|
|||
|
// http://sandbox.mc.edu/~bennet/cs110/tc/tctod.html
|
|||
|
// First check if the number is negative or positive by looking at the sign bit.
|
|||
|
// If it is positive, simply convert it to decimal.
|
|||
|
// If it is negative, make it positive by inverting the bits and adding one.
|
|||
|
// Then, convert the result to decimal.
|
|||
|
// The negative of this number is the value of the original binary.
|
|||
|
|
|||
|
if ($BinaryValue & 0x80) {
|
|||
|
|
|||
|
// negative number
|
|||
|
return (0 - ((~$BinaryValue & 0xFF) + 1));
|
|||
|
|
|||
|
} else {
|
|||
|
|
|||
|
// positive number
|
|||
|
return $BinaryValue;
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('LastArrayElement')) {
|
|||
|
function LastArrayElement($MyArray) {
|
|||
|
if (!is_array($MyArray)) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (empty($MyArray)) {
|
|||
|
return null;
|
|||
|
}
|
|||
|
foreach ($MyArray as $key => $value) {
|
|||
|
}
|
|||
|
return $value;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('safe_inc')) {
|
|||
|
function safe_inc(&$variable, $increment=1) {
|
|||
|
if (isset($variable)) {
|
|||
|
$variable += $increment;
|
|||
|
} else {
|
|||
|
$variable = $increment;
|
|||
|
}
|
|||
|
return true;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('CalculateCompressionRatioVideo')) {
|
|||
|
function CalculateCompressionRatioVideo(&$ThisFileInfo) {
|
|||
|
if (empty($ThisFileInfo['video'])) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (empty($ThisFileInfo['video']['resolution_x']) || empty($ThisFileInfo['video']['resolution_y'])) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (empty($ThisFileInfo['video']['bits_per_sample'])) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
switch ($ThisFileInfo['video']['dataformat']) {
|
|||
|
case 'bmp':
|
|||
|
case 'gif':
|
|||
|
case 'jpeg':
|
|||
|
case 'jpg':
|
|||
|
case 'png':
|
|||
|
case 'tiff':
|
|||
|
$FrameRate = 1;
|
|||
|
$PlaytimeSeconds = 1;
|
|||
|
$BitrateCompressed = $ThisFileInfo['filesize'] * 8;
|
|||
|
break;
|
|||
|
|
|||
|
default:
|
|||
|
if (!empty($ThisFileInfo['video']['frame_rate'])) {
|
|||
|
$FrameRate = $ThisFileInfo['video']['frame_rate'];
|
|||
|
} else {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (!empty($ThisFileInfo['playtime_seconds'])) {
|
|||
|
$PlaytimeSeconds = $ThisFileInfo['playtime_seconds'];
|
|||
|
} else {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (!empty($ThisFileInfo['video']['bitrate'])) {
|
|||
|
$BitrateCompressed = $ThisFileInfo['video']['bitrate'];
|
|||
|
} else {
|
|||
|
return false;
|
|||
|
}
|
|||
|
break;
|
|||
|
}
|
|||
|
$BitrateUncompressed = $ThisFileInfo['video']['resolution_x'] * $ThisFileInfo['video']['resolution_y'] * $ThisFileInfo['video']['bits_per_sample'] * $FrameRate;
|
|||
|
|
|||
|
$ThisFileInfo['video']['compression_ratio'] = $BitrateCompressed / $BitrateUncompressed;
|
|||
|
return true;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('CalculateCompressionRatioAudio')) {
|
|||
|
function CalculateCompressionRatioAudio(&$ThisFileInfo) {
|
|||
|
if (empty($ThisFileInfo['audio']['bitrate']) || empty($ThisFileInfo['audio']['channels']) || empty($ThisFileInfo['audio']['sample_rate']) || empty($ThisFileInfo['audio']['bits_per_sample'])) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
$ThisFileInfo['audio']['compression_ratio'] = $ThisFileInfo['audio']['bitrate'] / ($ThisFileInfo['audio']['channels'] * $ThisFileInfo['audio']['sample_rate'] * $ThisFileInfo['audio']['bits_per_sample']);
|
|||
|
return true;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('IsValidMIMEstring')) {
|
|||
|
function IsValidMIMEstring($mimestring) {
|
|||
|
if ((strlen($mimestring) >= 3) && (strpos($mimestring, '/') > 0) && (strpos($mimestring, '/') < (strlen($mimestring) - 1))) {
|
|||
|
return true;
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('IsWithinBitRange')) {
|
|||
|
function IsWithinBitRange($number, $maxbits, $signed=false) {
|
|||
|
if ($signed) {
|
|||
|
if (($number > (0 - pow(2, $maxbits - 1))) && ($number <= pow(2, $maxbits - 1))) {
|
|||
|
return true;
|
|||
|
}
|
|||
|
} else {
|
|||
|
if (($number >= 0) && ($number <= pow(2, $maxbits))) {
|
|||
|
return true;
|
|||
|
}
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('safe_parse_url')) {
|
|||
|
function safe_parse_url($url) {
|
|||
|
ob_start();
|
|||
|
$parts = parse_url($url);
|
|||
|
$errormessage = ob_get_contents();
|
|||
|
ob_end_clean();
|
|||
|
$parts['scheme'] = (isset($parts['scheme']) ? $parts['scheme'] : '');
|
|||
|
$parts['host'] = (isset($parts['host']) ? $parts['host'] : '');
|
|||
|
$parts['user'] = (isset($parts['user']) ? $parts['user'] : '');
|
|||
|
$parts['pass'] = (isset($parts['pass']) ? $parts['pass'] : '');
|
|||
|
$parts['path'] = (isset($parts['path']) ? $parts['path'] : '');
|
|||
|
$parts['query'] = (isset($parts['query']) ? $parts['query'] : '');
|
|||
|
return $parts;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (!function_exists('IsValidURL')) {
|
|||
|
function IsValidURL($url, $allowUserPass=false) {
|
|||
|
if ($url == '') {
|
|||
|
return false;
|
|||
|
}
|
|||
|
if ($allowUserPass !== true) {
|
|||
|
if (strstr($url, '@')) {
|
|||
|
// in the format http://user:pass@example.com or http://user@example.com
|
|||
|
// but could easily be somebody incorrectly entering an email address in place of a URL
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
if ($parts = safe_parse_url($url)) {
|
|||
|
if (($parts['scheme'] != 'http') && ($parts['scheme'] != 'https') && ($parts['scheme'] != 'ftp') && ($parts['scheme'] != 'gopher')) {
|
|||
|
return false;
|
|||
|
} elseif (!preg_match("#^[[:alnum:]]([-.]?[0-9a-z])*\.[a-z]{2,3}#i$", $parts['host'], $regs) && !preg_match('#^[0-9]{1,3}(\.[0-9]{1,3}){3}$#', $parts['host'])) {
|
|||
|
return false;
|
|||
|
} elseif (!preg_match("#^([[:alnum:]-]|[\_])*$#i", $parts['user'], $regs)) {
|
|||
|
return false;
|
|||
|
} elseif (!preg_match("#^([[:alnum:]-]|[\_])*$#i", $parts['pass'], $regs)) {
|
|||
|
return false;
|
|||
|
} elseif (!preg_match("#^[[:alnum:]/_\.@~-]*$#i", $parts['path'], $regs)) {
|
|||
|
return false;
|
|||
|
} elseif (!preg_match("#^[[:alnum:]?&=+:;_()%#/,\.-]*$#i", $parts['query'], $regs)) {
|
|||
|
return false;
|
|||
|
} else {
|
|||
|
return true;
|
|||
|
}
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
echo '<form action="'.htmlentities($_SERVER['PHP_SELF'], ENT_QUOTES).'" method="get">';
|
|||
|
echo 'Enter 4 hex bytes of MPEG-audio header (ie <I>FF FA 92 44</I>)<BR>';
|
|||
|
echo '<input type="text" name="HeaderHexBytes" value="'.htmlentities(isset($_POST['HeaderHexBytes']) ? strtoupper($_POST['HeaderHexBytes']) : '', ENT_QUOTES).'" size="11" maxlength="11">';
|
|||
|
echo '<input type="submit" name="Analyze" value="Analyze"></form>';
|
|||
|
echo '<hr>';
|
|||
|
|
|||
|
echo '<form action="'.htmlentities($_SERVER['PHP_SELF'], ENT_QUOTES).'" METHOD="get">';
|
|||
|
echo 'Generate a MPEG-audio 4-byte header from these values:<BR>';
|
|||
|
echo '<table border="0">';
|
|||
|
|
|||
|
$MPEGgenerateValues = array(
|
|||
|
'version'=>array('1', '2', '2.5'),
|
|||
|
'layer'=>array('I', 'II', 'III'),
|
|||
|
'protection'=>array('Y', 'N'),
|
|||
|
'bitrate'=>array('free', '8', '16', '24', '32', '40', '48', '56', '64', '80', '96', '112', '128', '144', '160', '176', '192', '224', '256', '288', '320', '352', '384', '416', '448'),
|
|||
|
'frequency'=>array('8000', '11025', '12000', '16000', '22050', '24000', '32000', '44100', '48000'),
|
|||
|
'padding'=>array('Y', 'N'),
|
|||
|
'private'=>array('Y', 'N'),
|
|||
|
'channelmode'=>array('stereo', 'joint stereo', 'dual channel', 'mono'),
|
|||
|
'modeextension'=>array('none', 'IS', 'MS', 'IS+MS', '4-31', '8-31', '12-31', '16-31'),
|
|||
|
'copyright'=>array('Y', 'N'),
|
|||
|
'original'=>array('Y', 'N'),
|
|||
|
'emphasis'=>array('none', '50/15ms', 'CCIT J.17')
|
|||
|
);
|
|||
|
|
|||
|
foreach ($MPEGgenerateValues as $name => $dataarray) {
|
|||
|
echo '<tr><th>'.$name.':</th><td><select name="'.$name.'">';
|
|||
|
foreach ($dataarray as $key => $value) {
|
|||
|
echo '<option'.((isset($_POST["$name"]) && ($_POST["$name"] == $value)) ? ' SELECTED' : '').'>'.$value.'</option>';
|
|||
|
}
|
|||
|
echo '</select></td></tr>';
|
|||
|
}
|
|||
|
|
|||
|
if (isset($_POST['bitrate'])) {
|
|||
|
echo '<tr><th>Frame Length:</th><td>'.(int) MPEGaudioFrameLength($_POST['bitrate'], $_POST['version'], $_POST['layer'], (($_POST['padding'] == 'Y') ? '1' : '0'), $_POST['frequency']).'</td></tr>';
|
|||
|
}
|
|||
|
echo '</table>';
|
|||
|
echo '<input type="submit" name="Generate" value="Generate"></form>';
|
|||
|
echo '<hr>';
|
|||
|
|
|||
|
|
|||
|
if (isset($_POST['Analyze']) && $_POST['HeaderHexBytes']) {
|
|||
|
|
|||
|
$headerbytearray = explode(' ', $_POST['HeaderHexBytes']);
|
|||
|
if (count($headerbytearray) != 4) {
|
|||
|
die('Invalid byte pattern');
|
|||
|
}
|
|||
|
$headerstring = '';
|
|||
|
foreach ($headerbytearray as $textbyte) {
|
|||
|
$headerstring .= chr(hexdec($textbyte));
|
|||
|
}
|
|||
|
|
|||
|
$MP3fileInfo['error'] = '';
|
|||
|
|
|||
|
$MPEGheaderRawArray = MPEGaudioHeaderDecode(substr($headerstring, 0, 4));
|
|||
|
|
|||
|
if (MPEGaudioHeaderValid($MPEGheaderRawArray, true)) {
|
|||
|
|
|||
|
$MP3fileInfo['raw'] = $MPEGheaderRawArray;
|
|||
|
|
|||
|
$MP3fileInfo['version'] = MPEGaudioVersionLookup($MP3fileInfo['raw']['version']);
|
|||
|
$MP3fileInfo['layer'] = MPEGaudioLayerLookup($MP3fileInfo['raw']['layer']);
|
|||
|
$MP3fileInfo['protection'] = MPEGaudioCRCLookup($MP3fileInfo['raw']['protection']);
|
|||
|
$MP3fileInfo['bitrate'] = MPEGaudioBitrateLookup($MP3fileInfo['version'], $MP3fileInfo['layer'], $MP3fileInfo['raw']['bitrate']);
|
|||
|
$MP3fileInfo['frequency'] = MPEGaudioFrequencyLookup($MP3fileInfo['version'], $MP3fileInfo['raw']['sample_rate']);
|
|||
|
$MP3fileInfo['padding'] = (bool) $MP3fileInfo['raw']['padding'];
|
|||
|
$MP3fileInfo['private'] = (bool) $MP3fileInfo['raw']['private'];
|
|||
|
$MP3fileInfo['channelmode'] = MPEGaudioChannelModeLookup($MP3fileInfo['raw']['channelmode']);
|
|||
|
$MP3fileInfo['channels'] = (($MP3fileInfo['channelmode'] == 'mono') ? 1 : 2);
|
|||
|
$MP3fileInfo['modeextension'] = MPEGaudioModeExtensionLookup($MP3fileInfo['layer'], $MP3fileInfo['raw']['modeextension']);
|
|||
|
$MP3fileInfo['copyright'] = (bool) $MP3fileInfo['raw']['copyright'];
|
|||
|
$MP3fileInfo['original'] = (bool) $MP3fileInfo['raw']['original'];
|
|||
|
$MP3fileInfo['emphasis'] = MPEGaudioEmphasisLookup($MP3fileInfo['raw']['emphasis']);
|
|||
|
|
|||
|
if ($MP3fileInfo['protection']) {
|
|||
|
$MP3fileInfo['crc'] = BigEndian2Int(substr($headerstring, 4, 2));
|
|||
|
}
|
|||
|
|
|||
|
if ($MP3fileInfo['frequency'] > 0) {
|
|||
|
$MP3fileInfo['framelength'] = MPEGaudioFrameLength($MP3fileInfo['bitrate'], $MP3fileInfo['version'], $MP3fileInfo['layer'], (int) $MP3fileInfo['padding'], $MP3fileInfo['frequency']);
|
|||
|
}
|
|||
|
if ($MP3fileInfo['bitrate'] != 'free') {
|
|||
|
$MP3fileInfo['bitrate'] *= 1000;
|
|||
|
}
|
|||
|
|
|||
|
} else {
|
|||
|
|
|||
|
$MP3fileInfo['error'] .= "\n".'Invalid MPEG audio header';
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
if (!$MP3fileInfo['error']) {
|
|||
|
unset($MP3fileInfo['error']);
|
|||
|
}
|
|||
|
|
|||
|
echo table_var_dump($MP3fileInfo);
|
|||
|
|
|||
|
} elseif (isset($_POST['Generate'])) {
|
|||
|
|
|||
|
// AAAA AAAA AAAB BCCD EEEE FFGH IIJJ KLMM
|
|||
|
|
|||
|
$headerbitstream = '11111111111'; // A - Frame sync (all bits set)
|
|||
|
|
|||
|
$MPEGversionLookup = array('2.5'=>'00', '2'=>'10', '1'=>'11');
|
|||
|
$headerbitstream .= $MPEGversionLookup[$_POST['version']]; // B - MPEG Audio version ID
|
|||
|
|
|||
|
$MPEGlayerLookup = array('III'=>'01', 'II'=>'10', 'I'=>'11');
|
|||
|
$headerbitstream .= $MPEGlayerLookup[$_POST['layer']]; // C - Layer description
|
|||
|
|
|||
|
$headerbitstream .= (($_POST['protection'] == 'Y') ? '0' : '1'); // D - Protection bit
|
|||
|
|
|||
|
$MPEGaudioBitrateLookup['1']['I'] = array('free'=>'0000', '32'=>'0001', '64'=>'0010', '96'=>'0011', '128'=>'0100', '160'=>'0101', '192'=>'0110', '224'=>'0111', '256'=>'1000', '288'=>'1001', '320'=>'1010', '352'=>'1011', '384'=>'1100', '416'=>'1101', '448'=>'1110');
|
|||
|
$MPEGaudioBitrateLookup['1']['II'] = array('free'=>'0000', '32'=>'0001', '48'=>'0010', '56'=>'0011', '64'=>'0100', '80'=>'0101', '96'=>'0110', '112'=>'0111', '128'=>'1000', '160'=>'1001', '192'=>'1010', '224'=>'1011', '256'=>'1100', '320'=>'1101', '384'=>'1110');
|
|||
|
$MPEGaudioBitrateLookup['1']['III'] = array('free'=>'0000', '32'=>'0001', '40'=>'0010', '48'=>'0011', '56'=>'0100', '64'=>'0101', '80'=>'0110', '96'=>'0111', '112'=>'1000', '128'=>'1001', '160'=>'1010', '192'=>'1011', '224'=>'1100', '256'=>'1101', '320'=>'1110');
|
|||
|
$MPEGaudioBitrateLookup['2']['I'] = array('free'=>'0000', '32'=>'0001', '48'=>'0010', '56'=>'0011', '64'=>'0100', '80'=>'0101', '96'=>'0110', '112'=>'0111', '128'=>'1000', '144'=>'1001', '160'=>'1010', '176'=>'1011', '192'=>'1100', '224'=>'1101', '256'=>'1110');
|
|||
|
$MPEGaudioBitrateLookup['2']['II'] = array('free'=>'0000', '8'=>'0001', '16'=>'0010', '24'=>'0011', '32'=>'0100', '40'=>'0101', '48'=>'0110', '56'=>'0111', '64'=>'1000', '80'=>'1001', '96'=>'1010', '112'=>'1011', '128'=>'1100', '144'=>'1101', '160'=>'1110');
|
|||
|
$MPEGaudioBitrateLookup['2']['III'] = $MPEGaudioBitrateLookup['2']['II'];
|
|||
|
$MPEGaudioBitrateLookup['2.5']['I'] = $MPEGaudioBitrateLookup['2']['I'];
|
|||
|
$MPEGaudioBitrateLookup['2.5']['II'] = $MPEGaudioBitrateLookup['2']['II'];
|
|||
|
$MPEGaudioBitrateLookup['2.5']['III'] = $MPEGaudioBitrateLookup['2']['II'];
|
|||
|
if (isset($MPEGaudioBitrateLookup[$_POST['version']][$_POST['layer']][$_POST['bitrate']])) {
|
|||
|
$headerbitstream .= $MPEGaudioBitrateLookup[$_POST['version']][$_POST['layer']][$_POST['bitrate']]; // E - Bitrate index
|
|||
|
} else {
|
|||
|
die('Invalid <B>Bitrate</B>');
|
|||
|
}
|
|||
|
|
|||
|
$MPEGaudioFrequencyLookup['1'] = array('44100'=>'00', '48000'=>'01', '32000'=>'10');
|
|||
|
$MPEGaudioFrequencyLookup['2'] = array('22050'=>'00', '24000'=>'01', '16000'=>'10');
|
|||
|
$MPEGaudioFrequencyLookup['2.5'] = array('11025'=>'00', '12000'=>'01', '8000'=>'10');
|
|||
|
if (isset($MPEGaudioFrequencyLookup[$_POST['version']][$_POST['frequency']])) {
|
|||
|
$headerbitstream .= $MPEGaudioFrequencyLookup[$_POST['version']][$_POST['frequency']]; // F - Sampling rate frequency index
|
|||
|
} else {
|
|||
|
die('Invalid <B>Frequency</B>');
|
|||
|
}
|
|||
|
|
|||
|
$headerbitstream .= (($_POST['padding'] == 'Y') ? '1' : '0'); // G - Padding bit
|
|||
|
|
|||
|
$headerbitstream .= (($_POST['private'] == 'Y') ? '1' : '0'); // H - Private bit
|
|||
|
|
|||
|
$MPEGaudioChannelModeLookup = array('stereo'=>'00', 'joint stereo'=>'01', 'dual channel'=>'10', 'mono'=>'11');
|
|||
|
$headerbitstream .= $MPEGaudioChannelModeLookup[$_POST['channelmode']]; // I - Channel Mode
|
|||
|
|
|||
|
$MPEGaudioModeExtensionLookup['I'] = array('4-31'=>'00', '8-31'=>'01', '12-31'=>'10', '16-31'=>'11');
|
|||
|
$MPEGaudioModeExtensionLookup['II'] = $MPEGaudioModeExtensionLookup['I'];
|
|||
|
$MPEGaudioModeExtensionLookup['III'] = array('none'=>'00', 'IS'=>'01', 'MS'=>'10', 'IS+MS'=>'11');
|
|||
|
if ($_POST['channelmode'] != 'joint stereo') {
|
|||
|
$headerbitstream .= '00';
|
|||
|
} elseif (isset($MPEGaudioModeExtensionLookup[$_POST['layer']][$_POST['modeextension']])) {
|
|||
|
$headerbitstream .= $MPEGaudioModeExtensionLookup[$_POST['layer']][$_POST['modeextension']]; // J - Mode extension (Only if Joint stereo)
|
|||
|
} else {
|
|||
|
die('Invalid <B>Mode Extension</B>');
|
|||
|
}
|
|||
|
|
|||
|
$headerbitstream .= (($_POST['copyright'] == 'Y') ? '1' : '0'); // K - Copyright
|
|||
|
|
|||
|
$headerbitstream .= (($_POST['original'] == 'Y') ? '1' : '0'); // L - Original
|
|||
|
|
|||
|
$MPEGaudioEmphasisLookup = array('none'=>'00', '50/15ms'=>'01', 'CCIT J.17'=>'11');
|
|||
|
if (isset($MPEGaudioEmphasisLookup[$_POST['emphasis']])) {
|
|||
|
$headerbitstream .= $MPEGaudioEmphasisLookup[$_POST['emphasis']]; // M - Emphasis
|
|||
|
} else {
|
|||
|
die('Invalid <B>Emphasis</B>');
|
|||
|
}
|
|||
|
|
|||
|
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 0, 8))), 2, '0', STR_PAD_LEFT)).' ';
|
|||
|
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 8, 8))), 2, '0', STR_PAD_LEFT)).' ';
|
|||
|
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 16, 8))), 2, '0', STR_PAD_LEFT)).' ';
|
|||
|
echo strtoupper(str_pad(dechex(bindec(substr($headerbitstream, 24, 8))), 2, '0', STR_PAD_LEFT)).'<BR>';
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioVersionLookup($rawversion) {
|
|||
|
$MPEGaudioVersionLookup = array('2.5', FALSE, '2', '1');
|
|||
|
return (isset($MPEGaudioVersionLookup["$rawversion"]) ? $MPEGaudioVersionLookup["$rawversion"] : FALSE);
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioLayerLookup($rawlayer) {
|
|||
|
$MPEGaudioLayerLookup = array(FALSE, 'III', 'II', 'I');
|
|||
|
return (isset($MPEGaudioLayerLookup["$rawlayer"]) ? $MPEGaudioLayerLookup["$rawlayer"] : FALSE);
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioBitrateLookup($version, $layer, $rawbitrate) {
|
|||
|
static $MPEGaudioBitrateLookup;
|
|||
|
if (empty($MPEGaudioBitrateLookup)) {
|
|||
|
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
|
|||
|
}
|
|||
|
return (isset($MPEGaudioBitrateLookup["$version"]["$layer"]["$rawbitrate"]) ? $MPEGaudioBitrateLookup["$version"]["$layer"]["$rawbitrate"] : FALSE);
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioFrequencyLookup($version, $rawfrequency) {
|
|||
|
static $MPEGaudioFrequencyLookup;
|
|||
|
if (empty($MPEGaudioFrequencyLookup)) {
|
|||
|
$MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray();
|
|||
|
}
|
|||
|
return (isset($MPEGaudioFrequencyLookup["$version"]["$rawfrequency"]) ? $MPEGaudioFrequencyLookup["$version"]["$rawfrequency"] : FALSE);
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioChannelModeLookup($rawchannelmode) {
|
|||
|
$MPEGaudioChannelModeLookup = array('stereo', 'joint stereo', 'dual channel', 'mono');
|
|||
|
return (isset($MPEGaudioChannelModeLookup["$rawchannelmode"]) ? $MPEGaudioChannelModeLookup["$rawchannelmode"] : FALSE);
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioModeExtensionLookup($layer, $rawmodeextension) {
|
|||
|
$MPEGaudioModeExtensionLookup['I'] = array('4-31', '8-31', '12-31', '16-31');
|
|||
|
$MPEGaudioModeExtensionLookup['II'] = array('4-31', '8-31', '12-31', '16-31');
|
|||
|
$MPEGaudioModeExtensionLookup['III'] = array('', 'IS', 'MS', 'IS+MS');
|
|||
|
return (isset($MPEGaudioModeExtensionLookup["$layer"]["$rawmodeextension"]) ? $MPEGaudioModeExtensionLookup["$layer"]["$rawmodeextension"] : FALSE);
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioEmphasisLookup($rawemphasis) {
|
|||
|
$MPEGaudioEmphasisLookup = array('none', '50/15ms', FALSE, 'CCIT J.17');
|
|||
|
return (isset($MPEGaudioEmphasisLookup["$rawemphasis"]) ? $MPEGaudioEmphasisLookup["$rawemphasis"] : FALSE);
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioCRCLookup($CRCbit) {
|
|||
|
// inverse boolean cast :)
|
|||
|
if ($CRCbit == '0') {
|
|||
|
return TRUE;
|
|||
|
} else {
|
|||
|
return FALSE;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
/////////////////////////////////////////////////////////////////
|
|||
|
/// getID3() by James Heinrich <info@getid3.org> //
|
|||
|
// available at http://getid3.sourceforge.net ///
|
|||
|
// or http://www.getid3.org ///
|
|||
|
/////////////////////////////////////////////////////////////////
|
|||
|
// //
|
|||
|
// getid3.mp3.php - part of getID3() //
|
|||
|
// See getid3.readme.txt for more details //
|
|||
|
// //
|
|||
|
/////////////////////////////////////////////////////////////////
|
|||
|
|
|||
|
// number of frames to scan to determine if MPEG-audio sequence is valid
|
|||
|
// Lower this number to 5-20 for faster scanning
|
|||
|
// Increase this number to 50+ for most accurate detection of valid VBR/CBR
|
|||
|
// mpeg-audio streams
|
|||
|
define('MPEG_VALID_CHECK_FRAMES', 35);
|
|||
|
|
|||
|
function getMP3headerFilepointer(&$fd, &$ThisFileInfo) {
|
|||
|
|
|||
|
getOnlyMPEGaudioInfo($fd, $ThisFileInfo, $ThisFileInfo['avdataoffset']);
|
|||
|
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio']['bitrate_mode'])) {
|
|||
|
$ThisFileInfo['audio']['bitrate_mode'] = strtolower($ThisFileInfo['mpeg']['audio']['bitrate_mode']);
|
|||
|
}
|
|||
|
|
|||
|
if (((isset($ThisFileInfo['id3v2']) && ($ThisFileInfo['avdataoffset'] > $ThisFileInfo['id3v2']['headerlength'])) || (!isset($ThisFileInfo['id3v2']) && ($ThisFileInfo['avdataoffset'] > 0)))) {
|
|||
|
|
|||
|
$ThisFileInfo['warning'] .= "\n".'Unknown data before synch ';
|
|||
|
if (isset($ThisFileInfo['id3v2']['headerlength'])) {
|
|||
|
$ThisFileInfo['warning'] .= '(ID3v2 header ends at '.$ThisFileInfo['id3v2']['headerlength'].', then '.($ThisFileInfo['avdataoffset'] - $ThisFileInfo['id3v2']['headerlength']).' bytes garbage, ';
|
|||
|
} else {
|
|||
|
$ThisFileInfo['warning'] .= '(should be at beginning of file, ';
|
|||
|
}
|
|||
|
$ThisFileInfo['warning'] .= 'synch detected at '.$ThisFileInfo['avdataoffset'].')';
|
|||
|
if ($ThisFileInfo['audio']['bitrate_mode'] == 'cbr') {
|
|||
|
if (!empty($ThisFileInfo['id3v2']['headerlength']) && (($ThisFileInfo['avdataoffset'] - $ThisFileInfo['id3v2']['headerlength']) == $ThisFileInfo['mpeg']['audio']['framelength'])) {
|
|||
|
$ThisFileInfo['warning'] .= '. This is a known problem with some versions of LAME (3.91, 3.92) DLL in CBR mode.';
|
|||
|
$ThisFileInfo['audio']['codec'] = 'LAME';
|
|||
|
} elseif (empty($ThisFileInfo['id3v2']['headerlength']) && ($ThisFileInfo['avdataoffset'] == $ThisFileInfo['mpeg']['audio']['framelength'])) {
|
|||
|
$ThisFileInfo['warning'] .= '. This is a known problem with some versions of LAME (3.91, 3.92) DLL in CBR mode.';
|
|||
|
$ThisFileInfo['audio']['codec'] = 'LAME';
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio']['layer']) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'II')) {
|
|||
|
$ThisFileInfo['audio']['dataformat'] = 'mp2';
|
|||
|
} elseif (isset($ThisFileInfo['mpeg']['audio']['layer']) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'I')) {
|
|||
|
$ThisFileInfo['audio']['dataformat'] = 'mp1';
|
|||
|
}
|
|||
|
if ($ThisFileInfo['fileformat'] == 'mp3') {
|
|||
|
switch ($ThisFileInfo['audio']['dataformat']) {
|
|||
|
case 'mp1':
|
|||
|
case 'mp2':
|
|||
|
case 'mp3':
|
|||
|
$ThisFileInfo['fileformat'] = $ThisFileInfo['audio']['dataformat'];
|
|||
|
break;
|
|||
|
|
|||
|
default:
|
|||
|
$ThisFileInfo['warning'] .= "\n".'Expecting [audio][dataformat] to be mp1/mp2/mp3 when fileformat == mp3, [audio][dataformat] actually "'.$ThisFileInfo['audio']['dataformat'].'"';
|
|||
|
break;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (empty($ThisFileInfo['fileformat'])) {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Synch not found';
|
|||
|
unset($ThisFileInfo['fileformat']);
|
|||
|
unset($ThisFileInfo['audio']['bitrate_mode']);
|
|||
|
unset($ThisFileInfo['avdataoffset']);
|
|||
|
unset($ThisFileInfo['avdataend']);
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
$ThisFileInfo['mime_type'] = 'audio/mpeg';
|
|||
|
$ThisFileInfo['audio']['lossless'] = false;
|
|||
|
|
|||
|
// Calculate playtime
|
|||
|
if (!isset($ThisFileInfo['playtime_seconds']) && isset($ThisFileInfo['audio']['bitrate']) && ($ThisFileInfo['audio']['bitrate'] > 0)) {
|
|||
|
$ThisFileInfo['playtime_seconds'] = ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']) * 8 / $ThisFileInfo['audio']['bitrate'];
|
|||
|
}
|
|||
|
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio']['LAME'])) {
|
|||
|
$ThisFileInfo['audio']['codec'] = 'LAME';
|
|||
|
if (!empty($ThisFileInfo['mpeg']['audio']['LAME']['long_version'])) {
|
|||
|
$ThisFileInfo['audio']['encoder'] = trim($ThisFileInfo['mpeg']['audio']['LAME']['long_version']);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
function decodeMPEGaudioHeader($fd, $offset, &$ThisFileInfo, $recursivesearch=true, $ScanAsCBR=false, $FastMPEGheaderScan=false) {
|
|||
|
|
|||
|
static $MPEGaudioVersionLookup;
|
|||
|
static $MPEGaudioLayerLookup;
|
|||
|
static $MPEGaudioBitrateLookup;
|
|||
|
static $MPEGaudioFrequencyLookup;
|
|||
|
static $MPEGaudioChannelModeLookup;
|
|||
|
static $MPEGaudioModeExtensionLookup;
|
|||
|
static $MPEGaudioEmphasisLookup;
|
|||
|
if (empty($MPEGaudioVersionLookup)) {
|
|||
|
$MPEGaudioVersionLookup = MPEGaudioVersionArray();
|
|||
|
$MPEGaudioLayerLookup = MPEGaudioLayerArray();
|
|||
|
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
|
|||
|
$MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray();
|
|||
|
$MPEGaudioChannelModeLookup = MPEGaudioChannelModeArray();
|
|||
|
$MPEGaudioModeExtensionLookup = MPEGaudioModeExtensionArray();
|
|||
|
$MPEGaudioEmphasisLookup = MPEGaudioEmphasisArray();
|
|||
|
}
|
|||
|
|
|||
|
if ($offset >= $ThisFileInfo['avdataend']) {
|
|||
|
$ThisFileInfo['error'] .= "\n".'end of file encounter looking for MPEG synch';
|
|||
|
return false;
|
|||
|
}
|
|||
|
fseek($fd, $offset, SEEK_SET);
|
|||
|
$headerstring = fread($fd, 1441); // worse-case max length = 32kHz @ 320kbps layer 3 = 1441 bytes/frame
|
|||
|
|
|||
|
// MP3 audio frame structure:
|
|||
|
// $aa $aa $aa $aa [$bb $bb] $cc...
|
|||
|
// where $aa..$aa is the four-byte mpeg-audio header (below)
|
|||
|
// $bb $bb is the optional 2-byte CRC
|
|||
|
// and $cc... is the audio data
|
|||
|
|
|||
|
$head4 = substr($headerstring, 0, 4);
|
|||
|
|
|||
|
static $MPEGaudioHeaderDecodeCache = array();
|
|||
|
if (isset($MPEGaudioHeaderDecodeCache[$head4])) {
|
|||
|
$MPEGheaderRawArray = $MPEGaudioHeaderDecodeCache[$head4];
|
|||
|
} else {
|
|||
|
$MPEGheaderRawArray = MPEGaudioHeaderDecode($head4);
|
|||
|
$MPEGaudioHeaderDecodeCache[$head4] = $MPEGheaderRawArray;
|
|||
|
}
|
|||
|
|
|||
|
static $MPEGaudioHeaderValidCache = array();
|
|||
|
|
|||
|
// Not in cache
|
|||
|
if (!isset($MPEGaudioHeaderValidCache[$head4])) {
|
|||
|
$MPEGaudioHeaderValidCache[$head4] = MPEGaudioHeaderValid($MPEGheaderRawArray);
|
|||
|
}
|
|||
|
|
|||
|
if ($MPEGaudioHeaderValidCache[$head4]) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['raw'] = $MPEGheaderRawArray;
|
|||
|
} else {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Invalid MPEG audio header at offset '.$offset;
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
if (!$FastMPEGheaderScan) {
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['version'] = $MPEGaudioVersionLookup[$ThisFileInfo['mpeg']['audio']['raw']['version']];
|
|||
|
$ThisFileInfo['mpeg']['audio']['layer'] = $MPEGaudioLayerLookup[$ThisFileInfo['mpeg']['audio']['raw']['layer']];
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['channelmode'] = $MPEGaudioChannelModeLookup[$ThisFileInfo['mpeg']['audio']['raw']['channelmode']];
|
|||
|
$ThisFileInfo['mpeg']['audio']['channels'] = (($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') ? 1 : 2);
|
|||
|
$ThisFileInfo['mpeg']['audio']['sample_rate'] = $MPEGaudioFrequencyLookup[$ThisFileInfo['mpeg']['audio']['version']][$ThisFileInfo['mpeg']['audio']['raw']['sample_rate']];
|
|||
|
$ThisFileInfo['mpeg']['audio']['protection'] = !$ThisFileInfo['mpeg']['audio']['raw']['protection'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['private'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['private'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['modeextension'] = $MPEGaudioModeExtensionLookup[$ThisFileInfo['mpeg']['audio']['layer']][$ThisFileInfo['mpeg']['audio']['raw']['modeextension']];
|
|||
|
$ThisFileInfo['mpeg']['audio']['copyright'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['copyright'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['original'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['original'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['emphasis'] = $MPEGaudioEmphasisLookup[$ThisFileInfo['mpeg']['audio']['raw']['emphasis']];
|
|||
|
|
|||
|
$ThisFileInfo['audio']['channels'] = $ThisFileInfo['mpeg']['audio']['channels'];
|
|||
|
$ThisFileInfo['audio']['sample_rate'] = $ThisFileInfo['mpeg']['audio']['sample_rate'];
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['protection']) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['crc'] = BigEndian2Int(substr($headerstring, 4, 2));
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['raw']['bitrate'] == 15) {
|
|||
|
// http://www.hydrogenaudio.org/?act=ST&f=16&t=9682&st=0
|
|||
|
$ThisFileInfo['warning'] .= "\n".'Invalid bitrate index (15), this is a known bug in free-format MP3s encoded by LAME v3.90 - 3.93.1';
|
|||
|
$ThisFileInfo['mpeg']['audio']['raw']['bitrate'] = 0;
|
|||
|
}
|
|||
|
$ThisFileInfo['mpeg']['audio']['padding'] = (bool) $ThisFileInfo['mpeg']['audio']['raw']['padding'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate'] = $MPEGaudioBitrateLookup[$ThisFileInfo['mpeg']['audio']['version']][$ThisFileInfo['mpeg']['audio']['layer']][$ThisFileInfo['mpeg']['audio']['raw']['bitrate']];
|
|||
|
|
|||
|
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && ($offset == $ThisFileInfo['avdataoffset'])) {
|
|||
|
// only skip multiple frame check if free-format bitstream found at beginning of file
|
|||
|
// otherwise is quite possibly simply corrupted data
|
|||
|
$recursivesearch = false;
|
|||
|
}
|
|||
|
|
|||
|
// For Layer II there are some combinations of bitrate and mode which are not allowed.
|
|||
|
if (!$FastMPEGheaderScan && ($ThisFileInfo['mpeg']['audio']['layer'] == 'II')) {
|
|||
|
|
|||
|
$ThisFileInfo['audio']['dataformat'] = 'mp2';
|
|||
|
switch ($ThisFileInfo['mpeg']['audio']['channelmode']) {
|
|||
|
|
|||
|
case 'mono':
|
|||
|
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') || ($ThisFileInfo['mpeg']['audio']['bitrate'] <= 192)) {
|
|||
|
// these are ok
|
|||
|
} else {
|
|||
|
$ThisFileInfo['error'] .= "\n".$ThisFileInfo['mpeg']['audio']['bitrate'].'kbps not allowed in Layer II, '.$ThisFileInfo['mpeg']['audio']['channelmode'].'.';
|
|||
|
return false;
|
|||
|
}
|
|||
|
break;
|
|||
|
|
|||
|
case 'stereo':
|
|||
|
case 'joint stereo':
|
|||
|
case 'dual channel':
|
|||
|
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') || ($ThisFileInfo['mpeg']['audio']['bitrate'] == 64) || ($ThisFileInfo['mpeg']['audio']['bitrate'] >= 96)) {
|
|||
|
// these are ok
|
|||
|
} else {
|
|||
|
$ThisFileInfo['error'] .= "\n".$ThisFileInfo['mpeg']['audio']['bitrate'].'kbps not allowed in Layer II, '.$ThisFileInfo['mpeg']['audio']['channelmode'].'.';
|
|||
|
return false;
|
|||
|
}
|
|||
|
break;
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
if ($ThisFileInfo['audio']['sample_rate'] > 0) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['framelength'] = MPEGaudioFrameLength($ThisFileInfo['mpeg']['audio']['bitrate'], $ThisFileInfo['mpeg']['audio']['version'], $ThisFileInfo['mpeg']['audio']['layer'], (int) $ThisFileInfo['mpeg']['audio']['padding'], $ThisFileInfo['audio']['sample_rate']);
|
|||
|
}
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['bitrate'] != 'free') {
|
|||
|
|
|||
|
$ThisFileInfo['audio']['bitrate'] = 1000 * $ThisFileInfo['mpeg']['audio']['bitrate'];
|
|||
|
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio']['framelength'])) {
|
|||
|
$nextframetestoffset = $offset + $ThisFileInfo['mpeg']['audio']['framelength'];
|
|||
|
} else {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Frame at offset('.$offset.') is has an invalid frame length.';
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
$ExpectedNumberOfAudioBytes = 0;
|
|||
|
|
|||
|
////////////////////////////////////////////////////////////////////////////////////
|
|||
|
// Variable-bitrate headers
|
|||
|
|
|||
|
if (substr($headerstring, 4 + 32, 4) == 'VBRI') {
|
|||
|
// Fraunhofer VBR header is hardcoded 'VBRI' at offset 0x24 (36)
|
|||
|
// specs taken from http://minnie.tuhs.org/pipermail/mp3encoder/2001-January/001800.html
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_method'] = 'Fraunhofer';
|
|||
|
$ThisFileInfo['audio']['codec'] = 'Fraunhofer';
|
|||
|
|
|||
|
$SideInfoData = substr($headerstring, 4 + 2, 32);
|
|||
|
|
|||
|
$FraunhoferVBROffset = 36;
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_encoder_version'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 4, 2));
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_encoder_delay'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 6, 2));
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_quality'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 8, 2));
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_bytes'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 10, 4));
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_frames'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 14, 4));
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_seek_offsets'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 18, 2));
|
|||
|
//$ThisFileInfo['mpeg']['audio']['reserved'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 20, 4)); // hardcoded $00 $01 $00 $02 - purpose unknown
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_seek_offsets_stride'] = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset + 24, 2));
|
|||
|
|
|||
|
$ExpectedNumberOfAudioBytes = $ThisFileInfo['mpeg']['audio']['VBR_bytes'];
|
|||
|
|
|||
|
$previousbyteoffset = $offset;
|
|||
|
for ($i = 0; $i < $ThisFileInfo['mpeg']['audio']['VBR_seek_offsets']; $i++) {
|
|||
|
$Fraunhofer_OffsetN = BigEndian2Int(substr($headerstring, $FraunhoferVBROffset, 2));
|
|||
|
$FraunhoferVBROffset += 2;
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_offsets_relative'][$i] = $Fraunhofer_OffsetN;
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_offsets_absolute'][$i] = $Fraunhofer_OffsetN + $previousbyteoffset;
|
|||
|
$previousbyteoffset += $Fraunhofer_OffsetN;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
} else {
|
|||
|
|
|||
|
// Xing VBR header is hardcoded 'Xing' at a offset 0x0D (13), 0x15 (21) or 0x24 (36)
|
|||
|
// depending on MPEG layer and number of channels
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
|
|||
|
// MPEG-1 (mono)
|
|||
|
$VBRidOffset = 4 + 17; // 0x15
|
|||
|
$SideInfoData = substr($headerstring, 4 + 2, 17);
|
|||
|
} else {
|
|||
|
// MPEG-1 (stereo, joint-stereo, dual-channel)
|
|||
|
$VBRidOffset = 4 + 32; // 0x24
|
|||
|
$SideInfoData = substr($headerstring, 4 + 2, 32);
|
|||
|
}
|
|||
|
} else { // 2 or 2.5
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
|
|||
|
// MPEG-2, MPEG-2.5 (mono)
|
|||
|
$VBRidOffset = 4 + 9; // 0x0D
|
|||
|
$SideInfoData = substr($headerstring, 4 + 2, 9);
|
|||
|
} else {
|
|||
|
// MPEG-2, MPEG-2.5 (stereo, joint-stereo, dual-channel)
|
|||
|
$VBRidOffset = 4 + 17; // 0x15
|
|||
|
$SideInfoData = substr($headerstring, 4 + 2, 17);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if ((substr($headerstring, $VBRidOffset, strlen('Xing')) == 'Xing') || (substr($headerstring, $VBRidOffset, strlen('Info')) == 'Info')) {
|
|||
|
// 'Xing' is traditional Xing VBR frame
|
|||
|
// 'Info' is LAME-encoded CBR (This was done to avoid CBR files to be recognized as traditional Xing VBR files by some decoders.)
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_method'] = 'Xing';
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['xing_flags_raw'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 4, 4));
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['xing_flags']['frames'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000001);
|
|||
|
$ThisFileInfo['mpeg']['audio']['xing_flags']['bytes'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000002);
|
|||
|
$ThisFileInfo['mpeg']['audio']['xing_flags']['toc'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000004);
|
|||
|
$ThisFileInfo['mpeg']['audio']['xing_flags']['vbr_scale'] = (bool) ($ThisFileInfo['mpeg']['audio']['xing_flags_raw'] & 0x00000008);
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['frames']) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_frames'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 8, 4));
|
|||
|
}
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['bytes']) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_bytes'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 12, 4));
|
|||
|
}
|
|||
|
|
|||
|
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && !empty($ThisFileInfo['mpeg']['audio']['VBR_frames']) && !empty($ThisFileInfo['mpeg']['audio']['VBR_bytes'])) {
|
|||
|
$framelengthfloat = $ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames'];
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
|
|||
|
// BitRate = (((FrameLengthInBytes / 4) - Padding) * SampleRate) / 12
|
|||
|
$ThisFileInfo['audio']['bitrate'] = ((($framelengthfloat / 4) - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 12;
|
|||
|
} else {
|
|||
|
// Bitrate = ((FrameLengthInBytes - Padding) * SampleRate) / 144
|
|||
|
$ThisFileInfo['audio']['bitrate'] = (($framelengthfloat - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 144;
|
|||
|
}
|
|||
|
$ThisFileInfo['mpeg']['audio']['framelength'] = floor($framelengthfloat);
|
|||
|
}
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['toc']) {
|
|||
|
$LAMEtocData = substr($headerstring, $VBRidOffset + 16, 100);
|
|||
|
for ($i = 0; $i < 100; $i++) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['toc'][$i] = ord($LAMEtocData{$i});
|
|||
|
}
|
|||
|
}
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['xing_flags']['vbr_scale']) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_scale'] = BigEndian2Int(substr($headerstring, $VBRidOffset + 116, 4));
|
|||
|
}
|
|||
|
|
|||
|
// http://gabriel.mp3-tech.org/mp3infotag.html
|
|||
|
if (substr($headerstring, $VBRidOffset + 120, 4) == 'LAME') {
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = substr($headerstring, $VBRidOffset + 120, 20);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['short_version'] = substr($ThisFileInfo['mpeg']['audio']['LAME']['long_version'], 0, 9);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = rtrim($ThisFileInfo['mpeg']['audio']['LAME']['long_version'], "\x55\xAA");
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['short_version'] >= 'LAME3.90.') {
|
|||
|
|
|||
|
// It the LAME tag was only introduced in LAME v3.90
|
|||
|
// http://www.hydrogenaudio.org/?act=ST&f=15&t=9933
|
|||
|
|
|||
|
// Offsets of various bytes in http://gabriel.mp3-tech.org/mp3infotag.html
|
|||
|
// are assuming a 'Xing' identifier offset of 0x24, which is the case for
|
|||
|
// MPEG-1 non-mono, but not for other combinations
|
|||
|
$LAMEtagOffsetContant = $VBRidOffset - 0x24;
|
|||
|
|
|||
|
// byte $9B VBR Quality
|
|||
|
// This field is there to indicate a quality level, although the scale was not precised in the original Xing specifications.
|
|||
|
// Actually overwrites original Xing bytes
|
|||
|
unset($ThisFileInfo['mpeg']['audio']['VBR_scale']);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['vbr_quality'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0x9B, 1));
|
|||
|
|
|||
|
// bytes $9C-$A4 Encoder short VersionString
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['short_version'] = substr($headerstring, $LAMEtagOffsetContant + 0x9C, 9);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['long_version'] = $ThisFileInfo['mpeg']['audio']['LAME']['short_version'];
|
|||
|
|
|||
|
// byte $A5 Info Tag revision + VBR method
|
|||
|
$LAMEtagRevisionVBRmethod = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xA5, 1));
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['tag_revision'] = ($LAMEtagRevisionVBRmethod & 0xF0) >> 4;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] = $LAMEtagRevisionVBRmethod & 0x0F;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['vbr_method'] = LAMEvbrMethodLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method']);
|
|||
|
|
|||
|
// byte $A6 Lowpass filter value
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['lowpass_frequency'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xA6, 1)) * 100;
|
|||
|
|
|||
|
// bytes $A7-$AE Replay Gain
|
|||
|
// http://privatewww.essex.ac.uk/~djmrob/replaygain/rg_data_format.html
|
|||
|
// bytes $A7-$AA : 32 bit floating point "Peak signal amplitude"
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] = BigEndian2Float(substr($headerstring, $LAMEtagOffsetContant + 0xA7, 4));
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAB, 2));
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAD, 2));
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] == 0) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] = false;
|
|||
|
}
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] != 0) {
|
|||
|
require_once(GETID3_INCLUDEPATH.'getid3.rgad.php');
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['name'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0xE000) >> 13;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['originator'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x1C00) >> 10;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['sign_bit'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x0200) >> 9;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['gain_adjust'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_radio'] & 0x01FF;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['name'] = RGADnameLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['name']);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['originator'] = RGADoriginatorLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['originator']);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['gain_db'] = RGADadjustmentLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['gain_adjust'], $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['raw']['sign_bit']);
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] !== false) {
|
|||
|
$ThisFileInfo['replay_gain']['radio']['peak'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'];
|
|||
|
}
|
|||
|
$ThisFileInfo['replay_gain']['radio']['originator'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['originator'];
|
|||
|
$ThisFileInfo['replay_gain']['radio']['adjustment'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['radio']['gain_db'];
|
|||
|
}
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] != 0) {
|
|||
|
require_once(GETID3_INCLUDEPATH.'getid3.rgad.php');
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['name'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0xE000) >> 13;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['originator'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x1C00) >> 10;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['sign_bit'] = ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x0200) >> 9;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['gain_adjust'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['RGAD_audiophile'] & 0x01FF;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['name'] = RGADnameLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['name']);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['originator'] = RGADoriginatorLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['originator']);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['gain_db'] = RGADadjustmentLookup($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['gain_adjust'], $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['raw']['sign_bit']);
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'] !== false) {
|
|||
|
$ThisFileInfo['replay_gain']['audiophile']['peak'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['peak_amplitude'];
|
|||
|
}
|
|||
|
$ThisFileInfo['replay_gain']['audiophile']['originator'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['originator'];
|
|||
|
$ThisFileInfo['replay_gain']['audiophile']['adjustment'] = $ThisFileInfo['mpeg']['audio']['LAME']['RGAD']['audiophile']['gain_db'];
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// byte $AF Encoding flags + ATH Type
|
|||
|
$EncodingFlagsATHtype = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xAF, 1));
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nspsytune'] = (bool) ($EncodingFlagsATHtype & 0x10);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nssafejoint'] = (bool) ($EncodingFlagsATHtype & 0x20);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nogap_next'] = (bool) ($EncodingFlagsATHtype & 0x40);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['encoding_flags']['nogap_prev'] = (bool) ($EncodingFlagsATHtype & 0x80);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['ath_type'] = $EncodingFlagsATHtype & 0x0F;
|
|||
|
|
|||
|
// byte $B0 if ABR {specified bitrate} else {minimal bitrate}
|
|||
|
$ABRbitrateMinBitrate = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB0, 1));
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] == 2) { // Average BitRate (ABR)
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['bitrate_abr'] = $ABRbitrateMinBitrate;
|
|||
|
} elseif ($ABRbitrateMinBitrate > 0) { // Variable BitRate (VBR) - minimum bitrate
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'] = $ABRbitrateMinBitrate;
|
|||
|
}
|
|||
|
|
|||
|
// bytes $B1-$B3 Encoder delays
|
|||
|
$EncoderDelays = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB1, 3));
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['encoder_delay'] = ($EncoderDelays & 0xFFF000) >> 12;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['end_padding'] = $EncoderDelays & 0x000FFF;
|
|||
|
|
|||
|
// byte $B4 Misc
|
|||
|
$MiscByte = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB4, 1));
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['noise_shaping'] = ($MiscByte & 0x03);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['stereo_mode'] = ($MiscByte & 0x1C) >> 2;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['not_optimal_quality'] = ($MiscByte & 0x20) >> 5;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['source_sample_freq'] = ($MiscByte & 0xC0) >> 6;
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['noise_shaping'] = $ThisFileInfo['mpeg']['audio']['LAME']['raw']['noise_shaping'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['stereo_mode'] = LAMEmiscStereoModeLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['stereo_mode']);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['not_optimal_quality'] = (bool) $ThisFileInfo['mpeg']['audio']['LAME']['raw']['not_optimal_quality'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['source_sample_freq'] = LAMEmiscSourceSampleFrequencyLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['source_sample_freq']);
|
|||
|
|
|||
|
// byte $B5 MP3 Gain
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['mp3_gain'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB5, 1), false, true);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_db'] = 1.5 * $ThisFileInfo['mpeg']['audio']['LAME']['raw']['mp3_gain'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_factor'] = pow(2, ($ThisFileInfo['mpeg']['audio']['LAME']['mp3_gain_db'] / 6));
|
|||
|
|
|||
|
// bytes $B6-$B7 Preset and surround info
|
|||
|
$PresetSurroundBytes = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB6, 2));
|
|||
|
// Reserved = ($PresetSurroundBytes & 0xC000);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['raw']['surround_info'] = ($PresetSurroundBytes & 0x3800);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['surround_info'] = LAMEsurroundInfoLookup($ThisFileInfo['mpeg']['audio']['LAME']['raw']['surround_info']);
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['preset_used_id'] = ($PresetSurroundBytes & 0x07FF);
|
|||
|
|
|||
|
// bytes $B8-$BB MusicLength
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xB8, 4));
|
|||
|
$ExpectedNumberOfAudioBytes = (($ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] > 0) ? $ThisFileInfo['mpeg']['audio']['LAME']['audio_bytes'] : $ThisFileInfo['mpeg']['audio']['VBR_bytes']);
|
|||
|
|
|||
|
// bytes $BC-$BD MusicCRC
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['music_crc'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xBC, 2));
|
|||
|
|
|||
|
// bytes $BE-$BF CRC-16 of Info Tag
|
|||
|
$ThisFileInfo['mpeg']['audio']['LAME']['lame_tag_crc'] = BigEndian2Int(substr($headerstring, $LAMEtagOffsetContant + 0xBE, 2));
|
|||
|
|
|||
|
|
|||
|
// LAME CBR
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['LAME']['raw']['vbr_method'] == 1) {
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
|
|||
|
if (empty($ThisFileInfo['mpeg']['audio']['bitrate']) || ($ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'] != 255)) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['LAME']['bitrate_min'];
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
} else {
|
|||
|
|
|||
|
// not Fraunhofer or Xing VBR methods, most likely CBR (but could be VBR with no header)
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
|
|||
|
if ($recursivesearch) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
|
|||
|
if (RecursiveFrameScanning($fd, $ThisFileInfo, $offset, $nextframetestoffset, true)) {
|
|||
|
$recursivesearch = false;
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
|
|||
|
}
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') {
|
|||
|
$ThisFileInfo['warning'] .= "\n".'VBR file with no VBR header. Bitrate values calculated from actual frame bitrates.';
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
if (($ExpectedNumberOfAudioBytes > 0) && ($ExpectedNumberOfAudioBytes != ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']))) {
|
|||
|
if (($ExpectedNumberOfAudioBytes - ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])) == 1) {
|
|||
|
$ThisFileInfo['warning'] .= "\n".'Last byte of data truncated (this is a known bug in Meracl ID3 Tag Writer before v1.3.5)';
|
|||
|
} elseif ($ExpectedNumberOfAudioBytes > ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])) {
|
|||
|
$ThisFileInfo['warning'] .= "\n".'Probable truncated file: expecting '.$ExpectedNumberOfAudioBytes.' bytes of audio data, only found '.($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']).' (short by '.($ExpectedNumberOfAudioBytes - ($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset'])).' bytes)';
|
|||
|
} else {
|
|||
|
$ThisFileInfo['warning'] .= "\n".'Too much data in file: expecting '.$ExpectedNumberOfAudioBytes.' bytes of audio data, found '.($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']).' ('.(($ThisFileInfo['avdataend'] - $ThisFileInfo['avdataoffset']) - $ExpectedNumberOfAudioBytes).' bytes too many)';
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (($ThisFileInfo['mpeg']['audio']['bitrate'] == 'free') && empty($ThisFileInfo['audio']['bitrate'])) {
|
|||
|
if (($offset == $ThisFileInfo['avdataoffset']) && empty($ThisFileInfo['mpeg']['audio']['VBR_frames'])) {
|
|||
|
$framebytelength = FreeFormatFrameLength($fd, $offset, $ThisFileInfo, true);
|
|||
|
if ($framebytelength > 0) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['framelength'] = $framebytelength;
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
|
|||
|
// BitRate = (((FrameLengthInBytes / 4) - Padding) * SampleRate) / 12
|
|||
|
$ThisFileInfo['audio']['bitrate'] = ((($framebytelength / 4) - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 12;
|
|||
|
} else {
|
|||
|
// Bitrate = ((FrameLengthInBytes - Padding) * SampleRate) / 144
|
|||
|
$ThisFileInfo['audio']['bitrate'] = (($framebytelength - intval($ThisFileInfo['mpeg']['audio']['padding'])) * $ThisFileInfo['mpeg']['audio']['sample_rate']) / 144;
|
|||
|
}
|
|||
|
} else {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Error calculating frame length of free-format MP3 without Xing/LAME header';
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') && isset($ThisFileInfo['mpeg']['audio']['VBR_frames']) && ($ThisFileInfo['mpeg']['audio']['VBR_frames'] > 1)) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_frames']--; // don't count the Xing / VBRI frame
|
|||
|
if (($ThisFileInfo['mpeg']['audio']['version'] == '1') && ($ThisFileInfo['mpeg']['audio']['layer'] == 'I')) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 384)) / 1000;
|
|||
|
} elseif ((($ThisFileInfo['mpeg']['audio']['version'] == '2') || ($ThisFileInfo['mpeg']['audio']['version'] == '2.5')) && ($ThisFileInfo['mpeg']['audio']['layer'] == 'III')) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 576)) / 1000;
|
|||
|
} else {
|
|||
|
$ThisFileInfo['mpeg']['audio']['VBR_bitrate'] = ((($ThisFileInfo['mpeg']['audio']['VBR_bytes'] / $ThisFileInfo['mpeg']['audio']['VBR_frames']) * 8) * ($ThisFileInfo['audio']['sample_rate'] / 1152)) / 1000;
|
|||
|
}
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['VBR_bitrate'] > 0) {
|
|||
|
$ThisFileInfo['audio']['bitrate'] = 1000 * $ThisFileInfo['mpeg']['audio']['VBR_bitrate'];
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['VBR_bitrate']; // to avoid confusion
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// End variable-bitrate headers
|
|||
|
////////////////////////////////////////////////////////////////////////////////////
|
|||
|
|
|||
|
if ($recursivesearch) {
|
|||
|
|
|||
|
if (!RecursiveFrameScanning($fd, $ThisFileInfo, $offset, $nextframetestoffset, $ScanAsCBR)) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
//if (false) {
|
|||
|
// // experimental side info parsing section - not returning anything useful yet
|
|||
|
//
|
|||
|
// $SideInfoBitstream = BigEndian2Bin($SideInfoData);
|
|||
|
// $SideInfoOffset = 0;
|
|||
|
//
|
|||
|
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
|
|||
|
// if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
|
|||
|
// // MPEG-1 (mono)
|
|||
|
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 9);
|
|||
|
// $SideInfoOffset += 9;
|
|||
|
// $SideInfoOffset += 5;
|
|||
|
// } else {
|
|||
|
// // MPEG-1 (stereo, joint-stereo, dual-channel)
|
|||
|
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 9);
|
|||
|
// $SideInfoOffset += 9;
|
|||
|
// $SideInfoOffset += 3;
|
|||
|
// }
|
|||
|
// } else { // 2 or 2.5
|
|||
|
// if ($ThisFileInfo['mpeg']['audio']['channelmode'] == 'mono') {
|
|||
|
// // MPEG-2, MPEG-2.5 (mono)
|
|||
|
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 8);
|
|||
|
// $SideInfoOffset += 8;
|
|||
|
// $SideInfoOffset += 1;
|
|||
|
// } else {
|
|||
|
// // MPEG-2, MPEG-2.5 (stereo, joint-stereo, dual-channel)
|
|||
|
// $ThisFileInfo['mpeg']['audio']['side_info']['main_data_begin'] = substr($SideInfoBitstream, $SideInfoOffset, 8);
|
|||
|
// $SideInfoOffset += 8;
|
|||
|
// $SideInfoOffset += 2;
|
|||
|
// }
|
|||
|
// }
|
|||
|
//
|
|||
|
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
|
|||
|
// for ($channel = 0; $channel < $ThisFileInfo['audio']['channels']; $channel++) {
|
|||
|
// for ($scfsi_band = 0; $scfsi_band < 4; $scfsi_band++) {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['scfsi'][$channel][$scfsi_band] = substr($SideInfoBitstream, $SideInfoOffset, 1);
|
|||
|
// $SideInfoOffset += 2;
|
|||
|
// }
|
|||
|
// }
|
|||
|
// }
|
|||
|
// for ($granule = 0; $granule < (($ThisFileInfo['mpeg']['audio']['version'] == '1') ? 2 : 1); $granule++) {
|
|||
|
// for ($channel = 0; $channel < $ThisFileInfo['audio']['channels']; $channel++) {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['part2_3_length'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 12);
|
|||
|
// $SideInfoOffset += 12;
|
|||
|
// $ThisFileInfo['mpeg']['audio']['big_values'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 9);
|
|||
|
// $SideInfoOffset += 9;
|
|||
|
// $ThisFileInfo['mpeg']['audio']['global_gain'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 8);
|
|||
|
// $SideInfoOffset += 8;
|
|||
|
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['scalefac_compress'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 4);
|
|||
|
// $SideInfoOffset += 4;
|
|||
|
// } else {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['scalefac_compress'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 9);
|
|||
|
// $SideInfoOffset += 9;
|
|||
|
// }
|
|||
|
// $ThisFileInfo['mpeg']['audio']['window_switching_flag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
|
|||
|
// $SideInfoOffset += 1;
|
|||
|
//
|
|||
|
// if ($ThisFileInfo['mpeg']['audio']['window_switching_flag'][$granule][$channel] == '1') {
|
|||
|
//
|
|||
|
// $ThisFileInfo['mpeg']['audio']['block_type'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 2);
|
|||
|
// $SideInfoOffset += 2;
|
|||
|
// $ThisFileInfo['mpeg']['audio']['mixed_block_flag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
|
|||
|
// $SideInfoOffset += 1;
|
|||
|
//
|
|||
|
// for ($region = 0; $region < 2; $region++) {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][$region] = substr($SideInfoBitstream, $SideInfoOffset, 5);
|
|||
|
// $SideInfoOffset += 5;
|
|||
|
// }
|
|||
|
// $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][2] = 0;
|
|||
|
//
|
|||
|
// for ($window = 0; $window < 3; $window++) {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['subblock_gain'][$granule][$channel][$window] = substr($SideInfoBitstream, $SideInfoOffset, 3);
|
|||
|
// $SideInfoOffset += 3;
|
|||
|
// }
|
|||
|
//
|
|||
|
// } else {
|
|||
|
//
|
|||
|
// for ($region = 0; $region < 3; $region++) {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['table_select'][$granule][$channel][$region] = substr($SideInfoBitstream, $SideInfoOffset, 5);
|
|||
|
// $SideInfoOffset += 5;
|
|||
|
// }
|
|||
|
//
|
|||
|
// $ThisFileInfo['mpeg']['audio']['region0_count'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 4);
|
|||
|
// $SideInfoOffset += 4;
|
|||
|
// $ThisFileInfo['mpeg']['audio']['region1_count'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 3);
|
|||
|
// $SideInfoOffset += 3;
|
|||
|
// $ThisFileInfo['mpeg']['audio']['block_type'][$granule][$channel] = 0;
|
|||
|
// }
|
|||
|
//
|
|||
|
// if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
|
|||
|
// $ThisFileInfo['mpeg']['audio']['preflag'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
|
|||
|
// $SideInfoOffset += 1;
|
|||
|
// }
|
|||
|
// $ThisFileInfo['mpeg']['audio']['scalefac_scale'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
|
|||
|
// $SideInfoOffset += 1;
|
|||
|
// $ThisFileInfo['mpeg']['audio']['count1table_select'][$granule][$channel] = substr($SideInfoBitstream, $SideInfoOffset, 1);
|
|||
|
// $SideInfoOffset += 1;
|
|||
|
// }
|
|||
|
// }
|
|||
|
//}
|
|||
|
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
function RecursiveFrameScanning(&$fd, &$ThisFileInfo, &$offset, &$nextframetestoffset, $ScanAsCBR) {
|
|||
|
for ($i = 0; $i < MPEG_VALID_CHECK_FRAMES; $i++) {
|
|||
|
// check next MPEG_VALID_CHECK_FRAMES frames for validity, to make sure we haven't run across a false synch
|
|||
|
if (($nextframetestoffset + 4) >= $ThisFileInfo['avdataend']) {
|
|||
|
// end of file
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
$nextframetestarray = array('error'=>'', 'warning'=>'', 'avdataend'=>$ThisFileInfo['avdataend'], 'avdataoffset'=>$ThisFileInfo['avdataoffset']);
|
|||
|
if (decodeMPEGaudioHeader($fd, $nextframetestoffset, $nextframetestarray, false)) {
|
|||
|
if ($ScanAsCBR) {
|
|||
|
// force CBR mode, used for trying to pick out invalid audio streams with
|
|||
|
// valid(?) VBR headers, or VBR streams with no VBR header
|
|||
|
if (!isset($nextframetestarray['mpeg']['audio']['bitrate']) || !isset($ThisFileInfo['mpeg']['audio']['bitrate']) || ($nextframetestarray['mpeg']['audio']['bitrate'] != $ThisFileInfo['mpeg']['audio']['bitrate'])) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// next frame is OK, get ready to check the one after that
|
|||
|
if (isset($nextframetestarray['mpeg']['audio']['framelength']) && ($nextframetestarray['mpeg']['audio']['framelength'] > 0)) {
|
|||
|
$nextframetestoffset += $nextframetestarray['mpeg']['audio']['framelength'];
|
|||
|
} else {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Frame at offset ('.$offset.') is has an invalid frame length.';
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
} else {
|
|||
|
|
|||
|
// next frame is not valid, note the error and fail, so scanning can contiue for a valid frame sequence
|
|||
|
$ThisFileInfo['error'] .= "\n".'Frame at offset ('.$offset.') is valid, but the next one at ('.$nextframetestoffset.') is not.';
|
|||
|
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
function FreeFormatFrameLength($fd, $offset, &$ThisFileInfo, $deepscan=false) {
|
|||
|
fseek($fd, $offset, SEEK_SET);
|
|||
|
$MPEGaudioData = fread($fd, 32768);
|
|||
|
|
|||
|
$SyncPattern1 = substr($MPEGaudioData, 0, 4);
|
|||
|
// may be different pattern due to padding
|
|||
|
$SyncPattern2 = $SyncPattern1{0}.$SyncPattern1{1}.chr(ord($SyncPattern1{2}) | 0x02).$SyncPattern1{3};
|
|||
|
if ($SyncPattern2 === $SyncPattern1) {
|
|||
|
$SyncPattern2 = $SyncPattern1{0}.$SyncPattern1{1}.chr(ord($SyncPattern1{2}) & 0xFD).$SyncPattern1{3};
|
|||
|
}
|
|||
|
|
|||
|
$framelength = false;
|
|||
|
$framelength1 = strpos($MPEGaudioData, $SyncPattern1, 4);
|
|||
|
$framelength2 = strpos($MPEGaudioData, $SyncPattern2, 4);
|
|||
|
if ($framelength1 > 4) {
|
|||
|
$framelength = $framelength1;
|
|||
|
}
|
|||
|
if (($framelength2 > 4) && ($framelength2 < $framelength1)) {
|
|||
|
$framelength = $framelength2;
|
|||
|
}
|
|||
|
if (!$framelength) {
|
|||
|
|
|||
|
// LAME 3.88 has a different value for modeextension on the first frame vs the rest
|
|||
|
$framelength1 = strpos($MPEGaudioData, substr($SyncPattern1, 0, 3), 4);
|
|||
|
$framelength2 = strpos($MPEGaudioData, substr($SyncPattern2, 0, 3), 4);
|
|||
|
|
|||
|
if ($framelength1 > 4) {
|
|||
|
$framelength = $framelength1;
|
|||
|
}
|
|||
|
if (($framelength2 > 4) && ($framelength2 < $framelength1)) {
|
|||
|
$framelength = $framelength2;
|
|||
|
}
|
|||
|
if (!$framelength) {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Cannot find next free-format synch pattern ('.PrintHexBytes($SyncPattern1).' or '.PrintHexBytes($SyncPattern2).') after offset '.$offset;
|
|||
|
return false;
|
|||
|
} else {
|
|||
|
$ThisFileInfo['warning'] .= "\n".'ModeExtension varies between first frame and other frames (known free-format issue in LAME 3.88)';
|
|||
|
$ThisFileInfo['audio']['codec'] = 'LAME';
|
|||
|
$ThisFileInfo['audio']['encoder'] = 'LAME3.88';
|
|||
|
$SyncPattern1 = substr($SyncPattern1, 0, 3);
|
|||
|
$SyncPattern2 = substr($SyncPattern2, 0, 3);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if ($deepscan) {
|
|||
|
|
|||
|
$ActualFrameLengthValues = array();
|
|||
|
$nextoffset = $offset + $framelength;
|
|||
|
while ($nextoffset < ($ThisFileInfo['avdataend'] - 6)) {
|
|||
|
fseek($fd, $nextoffset - 1, SEEK_SET);
|
|||
|
$NextSyncPattern = fread($fd, 6);
|
|||
|
if ((substr($NextSyncPattern, 1, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 1, strlen($SyncPattern2)) == $SyncPattern2)) {
|
|||
|
// good - found where expected
|
|||
|
$ActualFrameLengthValues[] = $framelength;
|
|||
|
} elseif ((substr($NextSyncPattern, 0, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 0, strlen($SyncPattern2)) == $SyncPattern2)) {
|
|||
|
// ok - found one byte earlier than expected (last frame wasn't padded, first frame was)
|
|||
|
$ActualFrameLengthValues[] = ($framelength - 1);
|
|||
|
$nextoffset--;
|
|||
|
} elseif ((substr($NextSyncPattern, 2, strlen($SyncPattern1)) == $SyncPattern1) || (substr($NextSyncPattern, 2, strlen($SyncPattern2)) == $SyncPattern2)) {
|
|||
|
// ok - found one byte later than expected (last frame was padded, first frame wasn't)
|
|||
|
$ActualFrameLengthValues[] = ($framelength + 1);
|
|||
|
$nextoffset++;
|
|||
|
} else {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Did not find expected free-format sync pattern at offset '.$nextoffset;
|
|||
|
return false;
|
|||
|
}
|
|||
|
$nextoffset += $framelength;
|
|||
|
}
|
|||
|
if (count($ActualFrameLengthValues) > 0) {
|
|||
|
$framelength = round(array_sum($ActualFrameLengthValues) / count($ActualFrameLengthValues));
|
|||
|
}
|
|||
|
}
|
|||
|
return $framelength;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
function getOnlyMPEGaudioInfo($fd, &$ThisFileInfo, $avdataoffset, $BitrateHistogram=false) {
|
|||
|
// looks for synch, decodes MPEG audio header
|
|||
|
|
|||
|
fseek($fd, $avdataoffset, SEEK_SET);
|
|||
|
$header = '';
|
|||
|
$SynchSeekOffset = 0;
|
|||
|
|
|||
|
if (!defined('CONST_FF')) {
|
|||
|
define('CONST_FF', chr(0xFF));
|
|||
|
define('CONST_E0', chr(0xE0));
|
|||
|
}
|
|||
|
|
|||
|
static $MPEGaudioVersionLookup;
|
|||
|
static $MPEGaudioLayerLookup;
|
|||
|
static $MPEGaudioBitrateLookup;
|
|||
|
if (empty($MPEGaudioVersionLookup)) {
|
|||
|
$MPEGaudioVersionLookup = MPEGaudioVersionArray();
|
|||
|
$MPEGaudioLayerLookup = MPEGaudioLayerArray();
|
|||
|
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
$header_len = strlen($header) - round(32768 / 2);
|
|||
|
while (true) {
|
|||
|
|
|||
|
if (($SynchSeekOffset > $header_len) && (($avdataoffset + $SynchSeekOffset) < $ThisFileInfo['avdataend']) && !feof($fd)) {
|
|||
|
|
|||
|
if ($SynchSeekOffset > 131072) {
|
|||
|
// if a synch's not found within the first 128k bytes, then give up
|
|||
|
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch within the first 131072 bytes';
|
|||
|
if (isset($ThisFileInfo['audio']['bitrate'])) {
|
|||
|
unset($ThisFileInfo['audio']['bitrate']);
|
|||
|
}
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio'])) {
|
|||
|
unset($ThisFileInfo['mpeg']['audio']);
|
|||
|
}
|
|||
|
if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || (count($ThisFileInfo['mpeg']) == 0))) {
|
|||
|
unset($ThisFileInfo['mpeg']);
|
|||
|
}
|
|||
|
return false;
|
|||
|
|
|||
|
} elseif ($header .= fread($fd, 32768)) {
|
|||
|
|
|||
|
// great
|
|||
|
$header_len = strlen($header) - round(32768 / 2);
|
|||
|
|
|||
|
} else {
|
|||
|
|
|||
|
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file';
|
|||
|
if (isset($ThisFileInfo['audio']['bitrate'])) {
|
|||
|
unset($ThisFileInfo['audio']['bitrate']);
|
|||
|
}
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio'])) {
|
|||
|
unset($ThisFileInfo['mpeg']['audio']);
|
|||
|
}
|
|||
|
if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || (count($ThisFileInfo['mpeg']) == 0))) {
|
|||
|
unset($ThisFileInfo['mpeg']);
|
|||
|
}
|
|||
|
return false;
|
|||
|
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (($SynchSeekOffset + 1) >= strlen($header)) {
|
|||
|
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file';
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
if (($header{$SynchSeekOffset} == CONST_FF) && ($header{($SynchSeekOffset + 1)} > CONST_E0)) { // synch detected
|
|||
|
|
|||
|
if (!isset($FirstFrameThisfileInfo) && !isset($ThisFileInfo['mpeg']['audio'])) {
|
|||
|
$FirstFrameThisfileInfo = $ThisFileInfo;
|
|||
|
$FirstFrameAVDataOffset = $avdataoffset + $SynchSeekOffset;
|
|||
|
if (!decodeMPEGaudioHeader($fd, $avdataoffset + $SynchSeekOffset, $FirstFrameThisfileInfo, false)) {
|
|||
|
// if this is the first valid MPEG-audio frame, save it in case it's a VBR header frame and there's
|
|||
|
// garbage between this frame and a valid sequence of MPEG-audio frames, to be restored below
|
|||
|
unset($FirstFrameThisfileInfo);
|
|||
|
}
|
|||
|
}
|
|||
|
$dummy = $ThisFileInfo; // only overwrite real data if valid header found
|
|||
|
|
|||
|
if (decodeMPEGaudioHeader($fd, $avdataoffset + $SynchSeekOffset, $dummy, true)) {
|
|||
|
|
|||
|
$ThisFileInfo = $dummy;
|
|||
|
$ThisFileInfo['avdataoffset'] = $avdataoffset + $SynchSeekOffset;
|
|||
|
switch ($ThisFileInfo['fileformat']) {
|
|||
|
case '':
|
|||
|
case 'id3':
|
|||
|
case 'ape':
|
|||
|
case 'mp3':
|
|||
|
$ThisFileInfo['fileformat'] = 'mp3';
|
|||
|
$ThisFileInfo['audio']['dataformat'] = 'mp3';
|
|||
|
}
|
|||
|
if (isset($FirstFrameThisfileInfo['mpeg']['audio']['bitrate_mode']) && ($FirstFrameThisfileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr')) {
|
|||
|
if (!CloseMatch($ThisFileInfo['audio']['bitrate'], $FirstFrameThisfileInfo['audio']['bitrate'], 1)) {
|
|||
|
// If there is garbage data between a valid VBR header frame and a sequence
|
|||
|
// of valid MPEG-audio frames the VBR data is no longer discarded.
|
|||
|
$ThisFileInfo = $FirstFrameThisfileInfo;
|
|||
|
$ThisFileInfo['avdataoffset'] = $FirstFrameAVDataOffset;
|
|||
|
$ThisFileInfo['fileformat'] = 'mp3';
|
|||
|
$ThisFileInfo['audio']['dataformat'] = 'mp3';
|
|||
|
$dummy = $ThisFileInfo;
|
|||
|
unset($dummy['mpeg']['audio']);
|
|||
|
$GarbageOffsetStart = $FirstFrameAVDataOffset + $FirstFrameThisfileInfo['mpeg']['audio']['framelength'];
|
|||
|
$GarbageOffsetEnd = $avdataoffset + $SynchSeekOffset;
|
|||
|
if (decodeMPEGaudioHeader($fd, $GarbageOffsetEnd, $dummy, true, true)) {
|
|||
|
|
|||
|
$ThisFileInfo = $dummy;
|
|||
|
$ThisFileInfo['avdataoffset'] = $GarbageOffsetEnd;
|
|||
|
$ThisFileInfo['warning'] .= "\n".'apparently-valid VBR header not used because could not find '.MPEG_VALID_CHECK_FRAMES.' consecutive MPEG-audio frames immediately after VBR header (garbage data for '.($GarbageOffsetEnd - $GarbageOffsetStart).' bytes between '.$GarbageOffsetStart.' and '.$GarbageOffsetEnd.'), but did find valid CBR stream starting at '.$GarbageOffsetEnd;
|
|||
|
|
|||
|
} else {
|
|||
|
|
|||
|
$ThisFileInfo['warning'] .= "\n".'using data from VBR header even though could not find '.MPEG_VALID_CHECK_FRAMES.' consecutive MPEG-audio frames immediately after VBR header (garbage data for '.($GarbageOffsetEnd - $GarbageOffsetStart).' bytes between '.$GarbageOffsetStart.' and '.$GarbageOffsetEnd.')';
|
|||
|
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio']['bitrate_mode']) && ($ThisFileInfo['mpeg']['audio']['bitrate_mode'] == 'vbr') && !isset($ThisFileInfo['mpeg']['audio']['VBR_method'])) {
|
|||
|
// VBR file with no VBR header
|
|||
|
$BitrateHistogram = true;
|
|||
|
}
|
|||
|
|
|||
|
if ($BitrateHistogram) {
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['stereo_distribution'] = array('stereo'=>0, 'joint stereo'=>0, 'dual channel'=>0, 'mono'=>0);
|
|||
|
$ThisFileInfo['mpeg']['audio']['version_distribution'] = array('1'=>0, '2'=>0, '2.5'=>0);
|
|||
|
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['version'] == '1') {
|
|||
|
if ($ThisFileInfo['mpeg']['audio']['layer'] == 'III') {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 40=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 320=>0);
|
|||
|
} elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'II') {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 320=>0, 384=>0);
|
|||
|
} elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 64=>0, 96=>0, 128=>0, 160=>0, 192=>0, 224=>0, 256=>0, 288=>0, 320=>0, 352=>0, 384=>0, 416=>0, 448=>0);
|
|||
|
}
|
|||
|
} elseif ($ThisFileInfo['mpeg']['audio']['layer'] == 'I') {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 32=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 144=>0, 160=>0, 176=>0, 192=>0, 224=>0, 256=>0);
|
|||
|
} else {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'] = array('free'=>0, 8=>0, 16=>0, 24=>0, 32=>0, 40=>0, 48=>0, 56=>0, 64=>0, 80=>0, 96=>0, 112=>0, 128=>0, 144=>0, 160=>0);
|
|||
|
}
|
|||
|
|
|||
|
$dummy = array('error'=>$ThisFileInfo['error'], 'warning'=>$ThisFileInfo['warning'], 'avdataend'=>$ThisFileInfo['avdataend'], 'avdataoffset'=>$ThisFileInfo['avdataoffset']);
|
|||
|
$synchstartoffset = $ThisFileInfo['avdataoffset'];
|
|||
|
|
|||
|
$FastMode = false;
|
|||
|
while (decodeMPEGaudioHeader($fd, $synchstartoffset, $dummy, false, false, $FastMode)) {
|
|||
|
$FastMode = true;
|
|||
|
$thisframebitrate = $MPEGaudioBitrateLookup[$MPEGaudioVersionLookup[$dummy['mpeg']['audio']['raw']['version']]][$MPEGaudioLayerLookup[$dummy['mpeg']['audio']['raw']['layer']]][$dummy['mpeg']['audio']['raw']['bitrate']];
|
|||
|
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_distribution'][$thisframebitrate]++;
|
|||
|
$ThisFileInfo['mpeg']['audio']['stereo_distribution'][$dummy['mpeg']['audio']['channelmode']]++;
|
|||
|
$ThisFileInfo['mpeg']['audio']['version_distribution'][$dummy['mpeg']['audio']['version']]++;
|
|||
|
if (empty($dummy['mpeg']['audio']['framelength'])) {
|
|||
|
$ThisFileInfo['warning'] .= "\n".'Invalid/missing framelength in histogram analysis - aborting';
|
|||
|
$synchstartoffset += 4;
|
|||
|
// return false;
|
|||
|
}
|
|||
|
$synchstartoffset += $dummy['mpeg']['audio']['framelength'];
|
|||
|
}
|
|||
|
|
|||
|
$bittotal = 0;
|
|||
|
$framecounter = 0;
|
|||
|
foreach ($ThisFileInfo['mpeg']['audio']['bitrate_distribution'] as $bitratevalue => $bitratecount) {
|
|||
|
$framecounter += $bitratecount;
|
|||
|
if ($bitratevalue != 'free') {
|
|||
|
$bittotal += ($bitratevalue * $bitratecount);
|
|||
|
}
|
|||
|
}
|
|||
|
if ($framecounter == 0) {
|
|||
|
$ThisFileInfo['error'] .= "\n".'Corrupt MP3 file: framecounter == zero';
|
|||
|
return false;
|
|||
|
}
|
|||
|
$ThisFileInfo['mpeg']['audio']['frame_count'] = $framecounter;
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate'] = 1000 * ($bittotal / $framecounter);
|
|||
|
|
|||
|
$ThisFileInfo['audio']['bitrate'] = $ThisFileInfo['mpeg']['audio']['bitrate'];
|
|||
|
|
|||
|
|
|||
|
// Definitively set VBR vs CBR, even if the Xing/LAME/VBRI header says differently
|
|||
|
$distinct_bitrates = 0;
|
|||
|
foreach ($ThisFileInfo['mpeg']['audio']['bitrate_distribution'] as $bitrate_value => $bitrate_count) {
|
|||
|
if ($bitrate_count > 0) {
|
|||
|
$distinct_bitrates++;
|
|||
|
}
|
|||
|
}
|
|||
|
if ($distinct_bitrates > 1) {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'vbr';
|
|||
|
} else {
|
|||
|
$ThisFileInfo['mpeg']['audio']['bitrate_mode'] = 'cbr';
|
|||
|
}
|
|||
|
$ThisFileInfo['audio']['bitrate_mode'] = $ThisFileInfo['mpeg']['audio']['bitrate_mode'];
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
break; // exit while()
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
$SynchSeekOffset++;
|
|||
|
if (($avdataoffset + $SynchSeekOffset) >= $ThisFileInfo['avdataend']) {
|
|||
|
// end of file/data
|
|||
|
|
|||
|
if (empty($ThisFileInfo['mpeg']['audio'])) {
|
|||
|
|
|||
|
$ThisFileInfo['error'] .= "\n".'could not find valid MPEG synch before end of file';
|
|||
|
if (isset($ThisFileInfo['audio']['bitrate'])) {
|
|||
|
unset($ThisFileInfo['audio']['bitrate']);
|
|||
|
}
|
|||
|
if (isset($ThisFileInfo['mpeg']['audio'])) {
|
|||
|
unset($ThisFileInfo['mpeg']['audio']);
|
|||
|
}
|
|||
|
if (isset($ThisFileInfo['mpeg']) && (!is_array($ThisFileInfo['mpeg']) || empty($ThisFileInfo['mpeg']))) {
|
|||
|
unset($ThisFileInfo['mpeg']);
|
|||
|
}
|
|||
|
return false;
|
|||
|
|
|||
|
}
|
|||
|
break;
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
$ThisFileInfo['audio']['bits_per_sample'] = 16;
|
|||
|
$ThisFileInfo['audio']['channels'] = $ThisFileInfo['mpeg']['audio']['channels'];
|
|||
|
$ThisFileInfo['audio']['channelmode'] = $ThisFileInfo['mpeg']['audio']['channelmode'];
|
|||
|
$ThisFileInfo['audio']['sample_rate'] = $ThisFileInfo['mpeg']['audio']['sample_rate'];
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
function MPEGaudioVersionArray() {
|
|||
|
static $MPEGaudioVersion = array('2.5', false, '2', '1');
|
|||
|
return $MPEGaudioVersion;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioLayerArray() {
|
|||
|
static $MPEGaudioLayer = array(false, 'III', 'II', 'I');
|
|||
|
return $MPEGaudioLayer;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioBitrateArray() {
|
|||
|
static $MPEGaudioBitrate;
|
|||
|
if (empty($MPEGaudioBitrate)) {
|
|||
|
$MPEGaudioBitrate['1']['I'] = array('free', 32, 64, 96, 128, 160, 192, 224, 256, 288, 320, 352, 384, 416, 448);
|
|||
|
$MPEGaudioBitrate['1']['II'] = array('free', 32, 48, 56, 64, 80, 96, 112, 128, 160, 192, 224, 256, 320, 384);
|
|||
|
$MPEGaudioBitrate['1']['III'] = array('free', 32, 40, 48, 56, 64, 80, 96, 112, 128, 160, 192, 224, 256, 320);
|
|||
|
$MPEGaudioBitrate['2']['I'] = array('free', 32, 48, 56, 64, 80, 96, 112, 128, 144, 160, 176, 192, 224, 256);
|
|||
|
$MPEGaudioBitrate['2']['II'] = array('free', 8, 16, 24, 32, 40, 48, 56, 64, 80, 96, 112, 128, 144, 160);
|
|||
|
$MPEGaudioBitrate['2']['III'] = $MPEGaudioBitrate['2']['II'];
|
|||
|
$MPEGaudioBitrate['2.5']['I'] = $MPEGaudioBitrate['2']['I'];
|
|||
|
$MPEGaudioBitrate['2.5']['II'] = $MPEGaudioBitrate['2']['II'];
|
|||
|
$MPEGaudioBitrate['2.5']['III'] = $MPEGaudioBitrate['2']['III'];
|
|||
|
}
|
|||
|
return $MPEGaudioBitrate;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioFrequencyArray() {
|
|||
|
static $MPEGaudioFrequency;
|
|||
|
if (empty($MPEGaudioFrequency)) {
|
|||
|
$MPEGaudioFrequency['1'] = array(44100, 48000, 32000);
|
|||
|
$MPEGaudioFrequency['2'] = array(22050, 24000, 16000);
|
|||
|
$MPEGaudioFrequency['2.5'] = array(11025, 12000, 8000);
|
|||
|
}
|
|||
|
return $MPEGaudioFrequency;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioChannelModeArray() {
|
|||
|
static $MPEGaudioChannelMode = array('stereo', 'joint stereo', 'dual channel', 'mono');
|
|||
|
return $MPEGaudioChannelMode;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioModeExtensionArray() {
|
|||
|
static $MPEGaudioModeExtension;
|
|||
|
if (empty($MPEGaudioModeExtension)) {
|
|||
|
$MPEGaudioModeExtension['I'] = array('4-31', '8-31', '12-31', '16-31');
|
|||
|
$MPEGaudioModeExtension['II'] = array('4-31', '8-31', '12-31', '16-31');
|
|||
|
$MPEGaudioModeExtension['III'] = array('', 'IS', 'MS', 'IS+MS');
|
|||
|
}
|
|||
|
return $MPEGaudioModeExtension;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioEmphasisArray() {
|
|||
|
static $MPEGaudioEmphasis = array('none', '50/15ms', false, 'CCIT J.17');
|
|||
|
return $MPEGaudioEmphasis;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
function MPEGaudioHeaderBytesValid($head4) {
|
|||
|
return MPEGaudioHeaderValid(MPEGaudioHeaderDecode($head4));
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioHeaderValid($rawarray, $echoerrors=false) {
|
|||
|
|
|||
|
if (($rawarray['synch'] & 0x0FFE) != 0x0FFE) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
static $MPEGaudioVersionLookup;
|
|||
|
static $MPEGaudioLayerLookup;
|
|||
|
static $MPEGaudioBitrateLookup;
|
|||
|
static $MPEGaudioFrequencyLookup;
|
|||
|
static $MPEGaudioChannelModeLookup;
|
|||
|
static $MPEGaudioModeExtensionLookup;
|
|||
|
static $MPEGaudioEmphasisLookup;
|
|||
|
if (empty($MPEGaudioVersionLookup)) {
|
|||
|
$MPEGaudioVersionLookup = MPEGaudioVersionArray();
|
|||
|
$MPEGaudioLayerLookup = MPEGaudioLayerArray();
|
|||
|
$MPEGaudioBitrateLookup = MPEGaudioBitrateArray();
|
|||
|
$MPEGaudioFrequencyLookup = MPEGaudioFrequencyArray();
|
|||
|
$MPEGaudioChannelModeLookup = MPEGaudioChannelModeArray();
|
|||
|
$MPEGaudioModeExtensionLookup = MPEGaudioModeExtensionArray();
|
|||
|
$MPEGaudioEmphasisLookup = MPEGaudioEmphasisArray();
|
|||
|
}
|
|||
|
|
|||
|
if (isset($MPEGaudioVersionLookup[$rawarray['version']])) {
|
|||
|
$decodedVersion = $MPEGaudioVersionLookup[$rawarray['version']];
|
|||
|
} else {
|
|||
|
if ($echoerrors) {
|
|||
|
echo "\n".'invalid Version ('.$rawarray['version'].')';
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (isset($MPEGaudioLayerLookup[$rawarray['layer']])) {
|
|||
|
$decodedLayer = $MPEGaudioLayerLookup[$rawarray['layer']];
|
|||
|
} else {
|
|||
|
if ($echoerrors) {
|
|||
|
echo "\n".'invalid Layer ('.$rawarray['layer'].')';
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (!isset($MPEGaudioBitrateLookup[$decodedVersion][$decodedLayer][$rawarray['bitrate']])) {
|
|||
|
if ($echoerrors) {
|
|||
|
echo "\n".'invalid Bitrate ('.$rawarray['bitrate'].')';
|
|||
|
}
|
|||
|
if ($rawarray['bitrate'] == 15) {
|
|||
|
// known issue in LAME 3.90 - 3.93.1 where free-format has bitrate ID of 15 instead of 0
|
|||
|
// let it go through here otherwise file will not be identified
|
|||
|
} else {
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
if (!isset($MPEGaudioFrequencyLookup[$decodedVersion][$rawarray['sample_rate']])) {
|
|||
|
if ($echoerrors) {
|
|||
|
echo "\n".'invalid Frequency ('.$rawarray['sample_rate'].')';
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (!isset($MPEGaudioChannelModeLookup[$rawarray['channelmode']])) {
|
|||
|
if ($echoerrors) {
|
|||
|
echo "\n".'invalid ChannelMode ('.$rawarray['channelmode'].')';
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (!isset($MPEGaudioModeExtensionLookup[$decodedLayer][$rawarray['modeextension']])) {
|
|||
|
if ($echoerrors) {
|
|||
|
echo "\n".'invalid Mode Extension ('.$rawarray['modeextension'].')';
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
if (!isset($MPEGaudioEmphasisLookup[$rawarray['emphasis']])) {
|
|||
|
if ($echoerrors) {
|
|||
|
echo "\n".'invalid Emphasis ('.$rawarray['emphasis'].')';
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
// These are just either set or not set, you can't mess that up :)
|
|||
|
// $rawarray['protection'];
|
|||
|
// $rawarray['padding'];
|
|||
|
// $rawarray['private'];
|
|||
|
// $rawarray['copyright'];
|
|||
|
// $rawarray['original'];
|
|||
|
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioHeaderDecode($Header4Bytes) {
|
|||
|
// AAAA AAAA AAAB BCCD EEEE FFGH IIJJ KLMM
|
|||
|
// A - Frame sync (all bits set)
|
|||
|
// B - MPEG Audio version ID
|
|||
|
// C - Layer description
|
|||
|
// D - Protection bit
|
|||
|
// E - Bitrate index
|
|||
|
// F - Sampling rate frequency index
|
|||
|
// G - Padding bit
|
|||
|
// H - Private bit
|
|||
|
// I - Channel Mode
|
|||
|
// J - Mode extension (Only if Joint stereo)
|
|||
|
// K - Copyright
|
|||
|
// L - Original
|
|||
|
// M - Emphasis
|
|||
|
|
|||
|
if (strlen($Header4Bytes) != 4) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
$MPEGrawHeader['synch'] = (BigEndian2Int(substr($Header4Bytes, 0, 2)) & 0xFFE0) >> 4;
|
|||
|
$MPEGrawHeader['version'] = (ord($Header4Bytes{1}) & 0x18) >> 3; // BB
|
|||
|
$MPEGrawHeader['layer'] = (ord($Header4Bytes{1}) & 0x06) >> 1; // CC
|
|||
|
$MPEGrawHeader['protection'] = (ord($Header4Bytes{1}) & 0x01); // D
|
|||
|
$MPEGrawHeader['bitrate'] = (ord($Header4Bytes{2}) & 0xF0) >> 4; // EEEE
|
|||
|
$MPEGrawHeader['sample_rate'] = (ord($Header4Bytes{2}) & 0x0C) >> 2; // FF
|
|||
|
$MPEGrawHeader['padding'] = (ord($Header4Bytes{2}) & 0x02) >> 1; // G
|
|||
|
$MPEGrawHeader['private'] = (ord($Header4Bytes{2}) & 0x01); // H
|
|||
|
$MPEGrawHeader['channelmode'] = (ord($Header4Bytes{3}) & 0xC0) >> 6; // II
|
|||
|
$MPEGrawHeader['modeextension'] = (ord($Header4Bytes{3}) & 0x30) >> 4; // JJ
|
|||
|
$MPEGrawHeader['copyright'] = (ord($Header4Bytes{3}) & 0x08) >> 3; // K
|
|||
|
$MPEGrawHeader['original'] = (ord($Header4Bytes{3}) & 0x04) >> 2; // L
|
|||
|
$MPEGrawHeader['emphasis'] = (ord($Header4Bytes{3}) & 0x03); // MM
|
|||
|
|
|||
|
return $MPEGrawHeader;
|
|||
|
}
|
|||
|
|
|||
|
function MPEGaudioFrameLength(&$bitrate, &$version, &$layer, $padding, &$samplerate) {
|
|||
|
static $AudioFrameLengthCache = array();
|
|||
|
|
|||
|
if (!isset($AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate])) {
|
|||
|
$AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate] = false;
|
|||
|
if ($bitrate != 'free') {
|
|||
|
|
|||
|
if ($version == '1') {
|
|||
|
|
|||
|
if ($layer == 'I') {
|
|||
|
|
|||
|
// For Layer I slot is 32 bits long
|
|||
|
$FrameLengthCoefficient = 48;
|
|||
|
$SlotLength = 4;
|
|||
|
|
|||
|
} else { // Layer II / III
|
|||
|
|
|||
|
// for Layer II and Layer III slot is 8 bits long.
|
|||
|
$FrameLengthCoefficient = 144;
|
|||
|
$SlotLength = 1;
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
} else { // MPEG-2 / MPEG-2.5
|
|||
|
|
|||
|
if ($layer == 'I') {
|
|||
|
|
|||
|
// For Layer I slot is 32 bits long
|
|||
|
$FrameLengthCoefficient = 24;
|
|||
|
$SlotLength = 4;
|
|||
|
|
|||
|
} elseif ($layer == 'II') {
|
|||
|
|
|||
|
// for Layer II and Layer III slot is 8 bits long.
|
|||
|
$FrameLengthCoefficient = 144;
|
|||
|
$SlotLength = 1;
|
|||
|
|
|||
|
} else { // III
|
|||
|
|
|||
|
// for Layer II and Layer III slot is 8 bits long.
|
|||
|
$FrameLengthCoefficient = 72;
|
|||
|
$SlotLength = 1;
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
// FrameLengthInBytes = ((Coefficient * BitRate) / SampleRate) + Padding
|
|||
|
// http://66.96.216.160/cgi-bin/YaBB.pl?board=c&action=display&num=1018474068
|
|||
|
// -> [Finding the next frame synch] on www.r3mix.net forums if the above link goes dead
|
|||
|
if ($samplerate > 0) {
|
|||
|
$NewFramelength = ($FrameLengthCoefficient * $bitrate * 1000) / $samplerate;
|
|||
|
$NewFramelength = floor($NewFramelength / $SlotLength) * $SlotLength; // round to next-lower multiple of SlotLength (1 byte for Layer II/III, 4 bytes for Layer I)
|
|||
|
if ($padding) {
|
|||
|
$NewFramelength += $SlotLength;
|
|||
|
}
|
|||
|
$AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate] = (int) $NewFramelength;
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
return $AudioFrameLengthCache[$bitrate][$version][$layer][$padding][$samplerate];
|
|||
|
}
|
|||
|
|
|||
|
function LAMEvbrMethodLookup($VBRmethodID) {
|
|||
|
static $LAMEvbrMethodLookup = array();
|
|||
|
if (empty($LAMEvbrMethodLookup)) {
|
|||
|
$LAMEvbrMethodLookup[0x00] = 'unknown';
|
|||
|
$LAMEvbrMethodLookup[0x01] = 'cbr';
|
|||
|
$LAMEvbrMethodLookup[0x02] = 'abr';
|
|||
|
$LAMEvbrMethodLookup[0x03] = 'vbr-old / vbr-rh';
|
|||
|
$LAMEvbrMethodLookup[0x04] = 'vbr-mtrh';
|
|||
|
$LAMEvbrMethodLookup[0x05] = 'vbr-new / vbr-mt';
|
|||
|
}
|
|||
|
return (isset($LAMEvbrMethodLookup[$VBRmethodID]) ? $LAMEvbrMethodLookup[$VBRmethodID] : '');
|
|||
|
}
|
|||
|
|
|||
|
function LAMEmiscStereoModeLookup($StereoModeID) {
|
|||
|
static $LAMEmiscStereoModeLookup = array();
|
|||
|
if (empty($LAMEmiscStereoModeLookup)) {
|
|||
|
$LAMEmiscStereoModeLookup[0] = 'mono';
|
|||
|
$LAMEmiscStereoModeLookup[1] = 'stereo';
|
|||
|
$LAMEmiscStereoModeLookup[2] = 'dual';
|
|||
|
$LAMEmiscStereoModeLookup[3] = 'joint';
|
|||
|
$LAMEmiscStereoModeLookup[4] = 'forced';
|
|||
|
$LAMEmiscStereoModeLookup[5] = 'auto';
|
|||
|
$LAMEmiscStereoModeLookup[6] = 'intensity';
|
|||
|
$LAMEmiscStereoModeLookup[7] = 'other';
|
|||
|
}
|
|||
|
return (isset($LAMEmiscStereoModeLookup[$StereoModeID]) ? $LAMEmiscStereoModeLookup[$StereoModeID] : '');
|
|||
|
}
|
|||
|
|
|||
|
function LAMEmiscSourceSampleFrequencyLookup($SourceSampleFrequencyID) {
|
|||
|
static $LAMEmiscSourceSampleFrequencyLookup = array();
|
|||
|
if (empty($LAMEmiscSourceSampleFrequencyLookup)) {
|
|||
|
$LAMEmiscSourceSampleFrequencyLookup[0] = '<= 32 kHz';
|
|||
|
$LAMEmiscSourceSampleFrequencyLookup[1] = '44.1 kHz';
|
|||
|
$LAMEmiscSourceSampleFrequencyLookup[2] = '48 kHz';
|
|||
|
$LAMEmiscSourceSampleFrequencyLookup[3] = '> 48kHz';
|
|||
|
}
|
|||
|
return (isset($LAMEmiscSourceSampleFrequencyLookup[$SourceSampleFrequencyID]) ? $LAMEmiscSourceSampleFrequencyLookup[$SourceSampleFrequencyID] : '');
|
|||
|
}
|
|||
|
|
|||
|
function LAMEsurroundInfoLookup($SurroundInfoID) {
|
|||
|
static $LAMEsurroundInfoLookup = array();
|
|||
|
if (empty($LAMEsurroundInfoLookup)) {
|
|||
|
$LAMEsurroundInfoLookup[0] = 'no surround info';
|
|||
|
$LAMEsurroundInfoLookup[1] = 'DPL encoding';
|
|||
|
$LAMEsurroundInfoLookup[2] = 'DPL2 encoding';
|
|||
|
$LAMEsurroundInfoLookup[3] = 'Ambisonic encoding';
|
|||
|
}
|
|||
|
return (isset($LAMEsurroundInfoLookup[$SurroundInfoID]) ? $LAMEsurroundInfoLookup[$SurroundInfoID] : 'reserved');
|
|||
|
}
|
|||
|
|
|||
|
for ($i = 0x00; $i <= 0xFF; $i++) {
|
|||
|
$head4 = "\xFF\xFE".chr($i)."\x00";
|
|||
|
$isvalid = MPEGaudioHeaderBytesValid($head4);
|
|||
|
echo '<div style="color: '.($isvalid ? 'green' : 'red').';">'.str_pad(strtoupper(dechex($i)), 2, '0', STR_PAD_LEFT).' = '.htmlentities(chr($i)).' = '.($isvalid ? 'valid' : 'INVALID').'</div>';
|
|||
|
}
|